Пређи на садржај

SB-277011-A — разлика између измена

С Википедије, слободне енциклопедије
Садржај обрисан Садржај додат
м +
м DEFAULTSORT → СОРТИРАЊЕ
 
(Није приказано 11 међуизмена 4 корисника)
Ред 1: Ред 1:
[[Датотека:SB2770112DACS.svg|десно|безоквира]]
{{Drugbox-lat
{{Drugbox-lat
| Verifiedfields =
| Verifiedfields =
Ред 11: Ред 12:
| tradename =
| tradename =
| legal_status =
| legal_status =
| routes_of_administration =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|}}
| CAS_number_Ref = {{cascite|correct|}}
| CAS_number =
| CAS_number =
| ATC_prefix =
| ATC_suffix =
| PubChem = 5311096
| PubChem = 5311096
| IUPHAR_ligand = 143
| IUPHAR_ligand = 143
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 85606
| ChEMBL = 85606
Ред 29: Ред 33:
<!--Chemical data-->
<!--Chemical data-->
| C=28 | H=30 | N=4 | O=1
| C=28 | H=30 | N=4 | O=1
| molecular_weight = 438,563 -{g/mol}-
| molecular_weight =
| smiles = c4cccc1c4nccc1C(=O)NC3CCC(CC3)CCN(CCc2c5)Cc2ccc5C#N
| smiles = c4cccc1c4nccc1C(=O)NC3CCC(CC3)CCN(CCc2c5)Cc2ccc5C#N
| InChI =
| InChIKey =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey =
}}
}}


-{'''SB-277,011A'''}- je lek koji deluje kao potentan i selektivan [[antagonist (farmakologija)|antagonist]] [[dopamin]]kog [[Dopaminski receptor D3|D<sub>3</sub> receptor]] [[Receptor (biohemija)|receptora]].<ref>{{cite journal | author = Stemp G, Ashmeade T, Branch CL, Hadley MS, Hunter AJ, Johnson CN, Nash DJ, Thewlis KM, Vong AK | title = Design and synthesis of trans-N-4-2-(6-cyano-1,2,3, 4-tetrahydroisoquinolin-2-yl)ethylcyclohexyl-4-quinolinecarboxamide (SB-277011): A potent and selective dopamine D(3) receptor antagonist with high oral bioavailability and CNS penetration in the rat | journal = Journal of medicinal chemistry | volume = 43 | issue = 9 | pages = 1878–85 | year = 2000 | pmid = 10794704 | doi=10.1021/jm000090i}}</ref> On je oko 80-100 puta selektivniji za D<sub>3</sub> u odnosu na D<sub>2</sub>.<ref>{{cite journal | author = Southam E, Lloyd A, Jennings CA, Cluderay JE, Cilia J, Gartlon JE, Jones DN | title = Effect of the selective dopamine D3 receptor antagonist SB-277011-A on regional c-Fos-like expression in rat forebrain | journal = Brain research | volume = 1149 | pages = 50–7 | year = 2007 | pmid = 17382304 | doi = 10.1016/j.brainres.2007.02.051 }}</ref> On nije [[parcijalni agonist]].<ref>{{cite journal | author = Reavill C, Taylor SG, Wood MD, Ashmeade T, Austin NE, Avenell KY, Boyfield I, Branch CL, Cilia J | title = Pharmacological actions of a novel, high-affinity, and selective human dopamine D(3) receptor antagonist, SB-277011-A | journal = The Journal of pharmacology and experimental therapeutics | volume = 294 | issue = 3 | pages = 1154–65 | year = 2000 | pmid = 10945872 }}</ref>
-{'''SB-277,011A'''}- je lek koji deluje kao potentan i selektivan [[antagonist (farmakologija)|antagonist]] [[dopamin]]kog [[Dopaminski receptor D3|D<sub>3</sub> receptor]] [[Receptor (biohemija)|receptora]].<ref>{{cite journal |vauthors=Stemp G, Ashmeade T, Branch CL, Hadley MS, Hunter AJ, Johnson CN, Nash DJ, Thewlis KM, Vong AK | title = Design and synthesis of trans-N-4-2-(6-cyano-1,2,3, 4-tetrahydroisoquinolin-2-yl)ethylcyclohexyl-4-quinolinecarboxamide (SB-277011): A potent and selective dopamine D(3) receptor antagonist with high oral bioavailability and CNS penetration in the rat | journal = Journal of medicinal chemistry | volume = 43 | issue = 9 | pages = 1878–85 | year = 2000 | pmid = 10794704 | doi=10.1021/jm000090i}}</ref> On je oko 80-100 puta selektivniji za D<sub>3</sub> u odnosu na D<sub>2</sub>.<ref>{{cite journal |vauthors=Southam E, Lloyd A, Jennings CA, Cluderay JE, Cilia J, Gartlon JE, Jones DN | title = Effect of the selective dopamine D3 receptor antagonist SB-277011-A on regional c-Fos-like expression in rat forebrain | journal = Brain research | volume = 1149 | pages = 50–7 | year = 2007 | pmid = 17382304 | doi = 10.1016/j.brainres.2007.02.051 }}</ref> On nije [[parcijalni agonist]].<ref>{{cite journal |vauthors=Reavill C, Taylor SG, Wood MD, Ashmeade T, Austin NE, Avenell KY, Boyfield I, Branch CL, Cilia J | title = Pharmacological actions of a novel, high-affinity, and selective human dopamine D(3) receptor antagonist, SB-277011-A | journal = The Journal of pharmacology and experimental therapeutics | volume = 294 | issue = 3 | pages = 1154–65 | year = 2000 | pmid = 10945872 }}</ref>


-{SB-277,011A}- se koristi za studiranje [[zavisnost|adikcije]] na [[psihostimulansi|stimulišuće]] droge poput [[nikotin]]a<ref>{{cite journal | author = Le Foll B, Schwartz JC, Sokoloff P | title = Disruption of nicotine conditioning by dopamine D(3) receptor ligands | journal = Molecular psychiatry | volume = 8 | issue = 2 | pages = 225–30 | year = 2003 | pmid = 12610655 | doi = 10.1038/sj.mp.4001202 }}</ref> i [[kokain]]a.<ref>{{cite journal | author = Vorel SR, Ashby Jr CR, Paul M, Liu X, Hayes R, Hagan JJ, Middlemiss DN, Stemp G, Gardner EL | title = Dopamine D3 receptor antagonism inhibits cocaine-seeking and cocaine-enhanced brain reward in rats | journal = Journal of Neuroscience | volume = 22 | issue = 21 | pages = 9595–603 | year = 2002 | pmid = 12417684 }}</ref><ref>{{cite journal | author = Di Ciano P, Underwood RJ, Hagan JJ Everitt BJ | title = Attenuation of cue-controlled cocaine-seeking by a selective D3 dopamine receptor antagonist SB-277011-A | journal = Neuropsychopharmacology | volume = 28 | issue = 2 | pages = 329–38 | year = 2003 | pmid = 12589386 | doi = 10.1038/sj.npp.1300148 }}</ref>
-{SB-277,011A}- se koristi za studiranje [[zavisnost|adikcije]] na [[psihostimulansi|stimulišuće]] droge poput [[nikotin]]a<ref>{{cite journal |vauthors= ((Le Foll B)), Schwartz JC, Sokoloff P | title = Disruption of nicotine conditioning by dopamine D(3) receptor ligands | journal = Molecular psychiatry | volume = 8 | issue = 2 | pages = 225–30 | year = 2003 | pmid = 12610655 | doi = 10.1038/sj.mp.4001202 }}</ref> i [[kokain]]a.<ref>{{cite journal |vauthors=Vorel SR, ((Ashby Jr CR)), Paul M, Liu X, Hayes R, Hagan JJ, Middlemiss DN, Stemp G, Gardner EL | title = Dopamine D3 receptor antagonism inhibits cocaine-seeking and cocaine-enhanced brain reward in rats | journal = Journal of Neuroscience | volume = 22 | issue = 21 | pages = 9595–603 | year = 2002 | pmid = 12417684 }}</ref><ref>{{cite journal |vauthors=Di Ciano P, Underwood RJ, Hagan JJ, Everitt BJ | title = Attenuation of cue-controlled cocaine-seeking by a selective D3 dopamine receptor antagonist SB-277011-A | journal = Neuropsychopharmacology | volume = 28 | issue = 2 | pages = 329–38 | year = 2003 | pmid = 12589386 | doi = 10.1038/sj.npp.1300148 }}</ref>


== Reference ==
== Reference ==
{{reflist|2}}
{{reflist|2}}

== Spoljašnje veze ==
{{Portal-lat|Medicina|Hemija}}

{{-}}
{{-}}
{{Dopaminergici-lat}}
{{Dopaminergici-lat}}


{{normativna kontrola}}
{{DEFAULTSORT:SB-277011-A}}



{{СОРТИРАЊЕ:SB-277011-A}}
[[Категорија:Допамински агонисти]]
[[Категорија:Допамински агонисти]]
[[Категорија:Хинолини]]
[[Категорија:Хинолини]]

Тренутна верзија на датум 15. октобар 2024. у 23:13

{{Drugbox-lat | Verifiedfields = | verifiedrevid = 449588534 | IUPAC_name = -{Ntrans-4-[2-(6-cijano-3,4-dihidroizohinolin-2(1H)-il)etil]cikloheksil}hinolin-4-karboksamid | image = SB277011A.png | width = 260 | image2 = | width2 =

| tradename = | legal_status = | routes_of_administration =

| metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ДаY | CAS_number = | ATC_prefix = | ATC_suffix = | PubChem = 5311096 | IUPHAR_ligand = 143 | DrugBank_Ref =  ДаY | DrugBank = | ChEMBL_Ref =  ДаY | ChEMBL = 85606

| C=28 | H=30 | N=4 | O=1 | molecular_weight = | smiles = c4cccc1c4nccc1C(=O)NC3CCC(CC3)CCN(CCc2c5)Cc2ccc5C#N | StdInChI_Ref =  ДаY | StdInChI = | StdInChIKey_Ref =  ДаY | StdInChIKey = }}

SB-277,011A je lek koji deluje kao potentan i selektivan antagonist dopaminkog D3 receptor receptora.[1] On je oko 80-100 puta selektivniji za D3 u odnosu na D2.[2] On nije parcijalni agonist.[3]

SB-277,011A se koristi za studiranje adikcije na stimulišuće droge poput nikotina[4] i kokaina.[5][6]

  1. ^ Stemp G, Ashmeade T, Branch CL, Hadley MS, Hunter AJ, Johnson CN, Nash DJ, Thewlis KM, Vong AK (2000). „Design and synthesis of trans-N-4-2-(6-cyano-1,2,3, 4-tetrahydroisoquinolin-2-yl)ethylcyclohexyl-4-quinolinecarboxamide (SB-277011): A potent and selective dopamine D(3) receptor antagonist with high oral bioavailability and CNS penetration in the rat”. Journal of medicinal chemistry. 43 (9): 1878—85. PMID 10794704. doi:10.1021/jm000090i. 
  2. ^ Southam E, Lloyd A, Jennings CA, Cluderay JE, Cilia J, Gartlon JE, Jones DN (2007). „Effect of the selective dopamine D3 receptor antagonist SB-277011-A on regional c-Fos-like expression in rat forebrain”. Brain research. 1149: 50—7. PMID 17382304. doi:10.1016/j.brainres.2007.02.051. 
  3. ^ Reavill C, Taylor SG, Wood MD, Ashmeade T, Austin NE, Avenell KY, Boyfield I, Branch CL, Cilia J (2000). „Pharmacological actions of a novel, high-affinity, and selective human dopamine D(3) receptor antagonist, SB-277011-A”. The Journal of pharmacology and experimental therapeutics. 294 (3): 1154—65. PMID 10945872. 
  4. ^ Le Foll B, Schwartz JC, Sokoloff P (2003). „Disruption of nicotine conditioning by dopamine D(3) receptor ligands”. Molecular psychiatry. 8 (2): 225—30. PMID 12610655. doi:10.1038/sj.mp.4001202. 
  5. ^ Vorel SR, Ashby Jr CR, Paul M, Liu X, Hayes R, Hagan JJ, Middlemiss DN, Stemp G, Gardner EL (2002). „Dopamine D3 receptor antagonism inhibits cocaine-seeking and cocaine-enhanced brain reward in rats”. Journal of Neuroscience. 22 (21): 9595—603. PMID 12417684. 
  6. ^ Di Ciano P, Underwood RJ, Hagan JJ, Everitt BJ (2003). „Attenuation of cue-controlled cocaine-seeking by a selective D3 dopamine receptor antagonist SB-277011-A”. Neuropsychopharmacology. 28 (2): 329—38. PMID 12589386. doi:10.1038/sj.npp.1300148. 

Spoljašnje veze

[уреди | уреди извор]