From Wikipedia, the free encyclopedia
TCS-1205
|
| Names
|
| IUPAC name
2-(5-Nitro-1H-indol-3-yl)-2-oxo-N-[(1R)-1-phenylethyl]acetamide
|
| Identifiers
|
|
|
|
|
|
|
| ChEMBL
|
|
| ChemSpider
|
|
|
|
|
Key: VCKKJKQZHHPPDR-LLVKDONJSA-N InChI=1S/C18H15N3O4/c1-11(12-5-3-2-4-6-12)20-18(23)17(22)15-10-19-16-8-7-13(21(24)25)9-14(15)16/h2-11,19H,1H3,(H,20,23)/t11-/m1/s1
|
CC(C1=CC=CC=C1)NC(=O)C(=O)C2=CNC3=C2C=C(C=C3)[N+](=O)[O-]
|
| Properties
|
|
|
C18H15N3O4
|
| Molar mass
|
337.335 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Chemical compound
TCS 1205 is an organic chemical compound. It is a benzodiazepine site agonist selective for certain sub-units.
TCS 1205 acts at the benzodiazepine binding site, it is selective for the α1 and α2 subunits of the GABAA receptor.[1] In vivo, it has anxiolytic effects but no sedative effects.[2][3]
Despite acting at the benzodiazepine receptor, it does not contain the benzodiazepine structure, it could therefore be classed as a nonbenzodiazepine.
- ^ "TCS 1205" (PDF). Certificate of Analysis. Tocris Bioscience.
- ^ "TCS 1205". AbMole BioScience.
- ^ Taliani S, Cosimelli B, Da Settimo F, Marini AM, La Motta C, Simorini F, et al. (June 2009). "Identification of anxiolytic/nonsedative agents among indol-3-ylglyoxylamides acting as functionally selective agonists at the gamma-aminobutyric acid-A (GABAA) alpha2 benzodiazepine receptor". Journal of Medicinal Chemistry. 52 (12): 3723–3734. doi:10.1021/jm9001154. PMID 19469479.
|
|---|
| Alcohols | |
|---|
| Barbiturates | |
|---|
| Benzodiazepines | |
|---|
| Carbamates | |
|---|
| Flavonoids | |
|---|
| Imidazoles | |
|---|
| Kava constituents | |
|---|
| Monoureides | |
|---|
| Neuroactive steroids | |
|---|
| Nonbenzodiazepines | |
|---|
| Phenols | |
|---|
| Piperidinediones | |
|---|
| Pyrazolopyridines | |
|---|
| Quinazolinones | |
|---|
| Volatiles/gases | |
|---|
| Others/unsorted |
- 3-Hydroxybutanal
- α-EMTBL
- AA-29504
- Alogabat
- Avermectins (e.g., ivermectin)
- Bromide compounds (e.g., lithium bromide, potassium bromide, sodium bromide)
- Carbamazepine
- Chloralose
- Chlormezanone
- Clomethiazole
- Darigabat
- DEABL
- Deuterated etifoxine
- Dihydroergolines (e.g., dihydroergocryptine, dihydroergosine, dihydroergotamine, ergoloid (dihydroergotoxine))
- DS2
- Efavirenz
- Etazepine
- Etifoxine
- Fenamates (e.g., flufenamic acid, mefenamic acid, niflumic acid, tolfenamic acid)
- Fluoxetine
- Flupirtine
- Hopantenic acid
- KRM-II-81
- Lanthanum
- Lavender oil
- Lignans (e.g., 4-O-methylhonokiol, honokiol, magnolol, obovatol)
- Loreclezole
- Menthyl isovalerate (validolum)
- Monastrol
- Nicotinic acid
- Nicotinamide
- Org 25,435
- Phenytoin
- Propanidid
- Retigabine (ezogabine)
- Safranal
- Seproxetine
- Stiripentol
- Sulfonylalkanes (e.g., sulfonmethane (sulfonal), tetronal, trional)
- Terpenoids (e.g., borneol)
- Topiramate
- Valerian constituents (e.g., isovaleric acid, isovaleramide, valerenic acid, valerenol)
|
|---|
|
