Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Zeranol: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 464400042 of page Zeranol for the Chem/Drugbox validation project (updated: 'CASNo'). |
ce |
||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Zeranol|oldid=464400042}} 464400042] of page [[Zeranol]] with values updated to verified values.}} |
|||
{{ |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| verifiedrevid = 470635756 |
|||
| IUPAC_name = (3''S'',7''R'')-7,14,16-trihydroxy-3-methyl-3,4,5,6,7,8,9,10,11,12-decahydro-1''H''-2-benzoxacyclotetradecin-1-one |
|||
| image = Alpha Zearalanol.svg |
|||
| width = 225px |
|||
<!--Clinical data--> |
|||
| tradename = Frideron, Ralabol, Ralgro, Ralone, Zerano |
|||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|||
| pregnancy_US = <!-- A / B / C / D / X --> |
|||
| pregnancy_category = |
|||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|||
| legal_CA = |
|||
| legal_UK = |
|||
| legal_US = |
|||
| legal_status = |
|||
| routes_of_administration = [[Oral administration|By mouth]] |
|||
| class = [[Nonsteroidal estrogen]] |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = |
|||
| protein_bound = |
|||
| metabolism = |
|||
| elimination_half-life = |
|||
| excretion = |
|||
<!-- Identifiers --> |
|||
| CAS_number_Ref = {{cascite|changed|??}} |
|||
| CAS_number = 26538-44-3 |
|||
| CAS_supplemental = |
|||
| ATCvet = |
|||
| ATC_prefix = |
|||
| ATC_suffix = |
|||
| ATC_supplemental = |
|||
| PubChem = 2999413 |
|||
| IUPHAR_ligand = |
|||
| DrugBank_Ref = |
|||
| DrugBank = |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 2271133 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 76LO2L2V39 |
| UNII = 76LO2L2V39 |
||
| KEGG = |
|||
| verifiedrevid = 457796104 |
|||
| ChEBI = |
|||
| ImageFile=Zeranol.png |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ImageSize=200px |
|||
| IUPACName=(3''S'',7''R'')-7,14,16-Trihydroxy-3-methyl-3,4,5,6,7,8,9,10,11,12-decahydro-1''H''-2-benzoxacyclotetradecin-1-one |
|||
| OtherNames=α-Zearalanol |
|||
|Section1={{Chembox Identifiers |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 4447689 |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 371463 |
| ChEMBL = 371463 |
||
| synonyms = Zearanol; α-Zearalanol; Zearalanol; MK-188; P-1496 |
|||
| InChI = 1/C18H24O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,14,19-21H,2,4-6,8-9H2,1H3/b7-3+/t12-,14+/m0/s1 |
|||
| InChIKey = FPQFYIAXQDXNOR-QDKLYSGJBF |
|||
<!--Chemical data--> |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| C=18 | H=26 | O=5 |
|||
| StdInChI = 1S/C18H24O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,14,19-21H,2,4-6,8-9H2,1H3/b7-3+/t12-,14+/m0/s1 |
|||
| SMILES = C[C@H]1CCC[C@H](O)CCCCCc2cc(O)cc(O)c2C(=O)O1 |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = FPQFYIAXQDXNOR-QDKLYSGJSA-N |
|||
| StdInChI = 1S/C18H26O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h10-12,14,19-21H,2-9H2,1H3/t12-,14+/m0/s1 |
|||
| CASNo_Ref = {{cascite|changed|??}} |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| CASNo = <!-- blanked - oldvalue: 26538-44-3 --> |
|||
| StdInChIKey = DWTTZBARDOXEAM-GXTWGEPZSA-N |
|||
| PubChem=33534 |
|||
| SMILES = C[C@H]1CCCC(CCCCCC2=CC(=CC(=C2C(=O)O1)O)O)O |
|||
}} |
|||
|Section2={{Chembox Properties |
|||
| C=18|H=26|O=5 |
|||
| Appearance= |
|||
| Density= |
|||
| MeltingPt= |
|||
| BoilingPt= |
|||
| Solubility= |
|||
}} |
|||
|Section3={{Chembox Hazards |
|||
| MainHazards= |
|||
| FlashPt= |
|||
| Autoignition= |
|||
}} |
|||
}} |
}} |
||
'''Zeranol''' ({{abbrlink|INN|International Nonproprietary Name}}, {{abbrlink|USAN|United States Adopted Name}}, {{abbrlink|BAN|British Approved Name}}) (brand names '''Frideron''', '''Ralabol''', '''Ralgro''', '''Ralone''', '''Zerano'''; developmental code names '''MK-188''', '''P-1496'''), or '''zearanol''', also known as '''α-zearalanol''' or simply '''zearalanol''', is a [[synthetic compound|synthetic]] [[nonsteroidal estrogen]] of the [[resorcylic acid lactone]] group related to [[mycoestrogen]]s found in [[fungi]] in the ''[[Fusarium]]'' [[genus]] and is used mainly as an [[anabolic]] [[drug|agent]] in [[veterinary medicine]].<ref name="Elks2014">{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA350|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=350–}}</ref><ref name="IndexNominum2000">{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA1105|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=1105–}}</ref><ref name="MortonHall2012">{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA295|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1|pages=295–}}</ref> |
|||
Zeranol is approved for use as a growth promoter in livestock, including beef cattle, under the brand name '''Ralgro''' (by [[Merck Animal Health]]) in the [[United States]].<ref>{{cite web | title = Implant Strategies for Finishing Cattle using Revalor® (trenbolone acetate and estradiol), Finaplix® (trenbolone) and/or Ralgro® (zeranol) | vauthors = Nichols W, Hutcheson J, Streeter M, Corrigan M, Nuttelman B | url = http://www.depts.ttu.edu/afs/implantdb/dbhome/Revalor%20Tech%20Bulletin%2012.pdf }}</ref> In [[Canada]], it is approved for use in beef cattle only.<ref>Health Canada, [http://www.hc-sc.gc.ca/dhp-mps/vet/faq/growth_hormones_promoters_croissance_hormonaux_stimulateurs-eng.php Questions and Answers - Hormonal Growth Promoters]</ref> Its application is not approved for use in the [[European Union]]. However, it is marketed under the brand name '''Ralone''' in [[Spain]].<ref name="IndexNominum2000" /> |
|||
Although zeranol may increase cancer cell proliferation in already existing [[breast cancer]],<ref>{{cite journal | vauthors = Xu P, Ye W, Jen R, Lin SH, Kuo CT, Lin YC | title = Mitogenic activity of zeranol in human breast cancer cells is enhanced by leptin and suppressed by gossypol | journal = Anticancer Research | volume = 29 | issue = 11 | pages = 4621–4628 | date = November 2009 | pmid = 20032412 }}</ref> dietary exposure from the use of zeranol-containing implants in cattle is insignificant.<ref>{{cite journal | vauthors = Lindsay DG | title = Zeranol--a 'nature-identical' oestrogen? | journal = Food and Chemical Toxicology | volume = 23 | issue = 8 | pages = 767–774 | date = August 1985 | pmid = 2931335 | doi = 10.1016/0278-6915(85)90273-x }}</ref> Zeranol may be found as a contaminant in fungus-infected crops. It is 3 to 4 times more potent as an estrogen than the related compound [[zearalenone]].<ref>{{cite journal | vauthors = Mirocha CJ, Schauerhamer B, Christensen CM, Niku-Paavola ML, Nummi M | title = Incidence of zearalenol (Fusarium mycotoxin) in animal feed | journal = Applied and Environmental Microbiology | volume = 38 | issue = 4 | pages = 749–750 | date = October 1979 | pmid = 161492 | pmc = 243572 | doi = 10.1128/AEM.38.4.749-750.1979 | bibcode = 1979ApEnM..38..749M }}</ref> It is a metabolite of zearalenone.<ref>{{cite journal | vauthors = Miles CO, Erasmuson AF, Wilkins AL, Towers NR, Smith BL, Garthwaite I, Scahill BG, Hansen RP | display-authors = 6 | title = Ovine metabolism of zearalenone to α-zearalanol (zeranol). | journal = Journal of Agricultural and Food Chemistry | date = October 1996 | volume = 44 | issue = 10 | pages = 3244–3250 | doi = 10.1021/jf9601325 }}</ref> |
|||
== See also == |
|||
* [[α-Zearalenol]] |
|||
* [[β-Zearalenol]] |
|||
* [[Taleranol]] |
|||
* [[Zearalanone]] |
|||
* [[Beef hormone controversy]] |
|||
== References == |
|||
{{Reflist}} |
|||
{{Toxins}} |
|||
{{Xenoestrogens}} |
|||
{{Estrogen receptor modulators}} |
|||
{{Xenobiotic-sensing receptor modulators}} |
|||
[[Category:Lactones]] |
|||
[[Category:Mycoestrogens]] |
|||
[[Category:Mycotoxins]] |
|||
[[Category:Resorcinols]] |
|||
[[Category:Veterinary drugs]] |
|||
[[Category:World Anti-Doping Agency prohibited substances]] |