Terflavin B: Difference between revisions
Content deleted Content added
m cleanup |
m deprecated stub category (via WP:JWB) |
||
| (16 intermediate revisions by 8 users not shown) | |||
| Line 1: | Line 1: | ||
{{chembox |
{{chembox |
||
| Watchedfields = changed |
|||
| verifiedrevid = 403997908 |
|||
| Name = Terflavin B |
| Name = Terflavin B |
||
| ImageFile = Terflavin B. |
| ImageFile = Terflavin B.png |
||
| ImageSize = 200px |
|||
| ImageName = Chemical structure of terflavin B |
| ImageName = Chemical structure of terflavin B |
||
| ImageAlt = Chemical structure of terflavin B |
| ImageAlt = Chemical structure of terflavin B |
||
| IUPACName = |
| IUPACName = |
||
| OtherNames = <!-- <br> --> |
| OtherNames = <!-- <br> --> |
||
|Section1= |
|Section1={{Chembox Identifiers |
||
| CASNo_Ref = {{cascite|correct|??}} |
|||
| CASNo = 103744-86-1 |
| CASNo = 103744-86-1 |
||
| |
| CASNoOther = |
||
| CASOther = |
|||
| PubChem = 44584734 |
| PubChem = 44584734 |
||
| SMILES = C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)O)O)O)OC(=O)C3=CC(=C(C(=C3C4=C(C(=C5C6=C4C(=O)OC7=C6C(=CC(=C7O)O)C(=O)O5)O)O)O)O)O |
| SMILES = C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)O)O)O)OC(=O)C3=CC(=C(C(=C3C4=C(C(=C5C6=C4C(=O)OC7=C6C(=CC(=C7O)O)C(=O)O5)O)O)O)O)O |
||
| Line 16: | Line 17: | ||
| MeSHName = |
| MeSHName = |
||
}} |
}} |
||
|Section2= |
|Section2={{Chembox Properties |
||
| Formula = C<sub>34</sub>H<sub>24</sub>O<sub>22</sub> |
| Formula = C<sub>34</sub>H<sub>24</sub>O<sub>22</sub> |
||
| MolarMass = 784.54 g/mol |
| MolarMass = 784.54 g/mol |
||
| ExactMass = 784.075922 u |
|||
| Appearance = |
| Appearance = |
||
| Density = |
| Density = |
||
| MeltingPt = |
| MeltingPt = |
||
| BoilingPt = |
| BoilingPt = |
||
| Solubility = |
| Solubility = |
||
}} |
}} |
||
}} |
}} |
||
'''Terflavin B''' is |
'''Terflavin B''' is an [[ellagitannin]], a type of hydrolysable tannin. It can be found in ''Myrobalanus chebula'' (''[[Terminalia chebula]]''), the black chebulic, and in ''[[Terminalia catappa]]'', the Indian almond.<ref>[http://www.liberherbarum.com/In4992.htm Terflavin B on www.liberherbarum.com]</ref> |
||
It is formed from a [[nonahydroxytriphenic acid]] dilactone and a [[gallic acid]] linked to a glucose molecules. |
|||
| ⚫ | |||
| ⚫ | |||
{{reflist}} |
{{reflist}} |
||
{{Ellagitannin}} |
|||
{{Hydrolysable tannin}} |
|||
| ⚫ | |||
[[category:tannins]] |
|||
| ⚫ | |||
[[Category:Benzoates]] |
|||
{{ |
{{aromatic-stub}} |
||