Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Rescinnamine: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{drugbox}} taken from revid 456667820 of page Rescinnamine for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Navbox. |
||
Line 1: | Line 1: | ||
{{short description|Chemical compound}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid [{{fullurl:Rescinnamine|oldid=456667820}} 456667820] of page [[Rescinnamine]] with values updated to verified values.}} |
|||
{{Drugbox |
{{Drugbox |
||
⚫ | |||
| Verifiedfields = changed |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| image = Rescinnamine.svg |
| image = Rescinnamine.svg |
||
| image2 = [[File:Rescinnamine.png|frameless|rescinnamine 3D BS]] |
|||
| width = 300 |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = Moderil, Cinnasil, Anaprel |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_status = Rx-only |
| legal_status = Rx-only |
||
| routes_of_administration = |
| routes_of_administration = [[Oral administration|By mouth]] |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
Line 17: | Line 16: | ||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| IUPHAR_ligand = 7098 |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 24815-24-5 |
| CAS_number = 24815-24-5 |
||
Line 30: | Line 28: | ||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 4444446 |
| ChemSpiderID = 4444446 |
||
| UNII_Ref = {{fdacite| |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = Q6W1F7DJ2D |
| UNII = Q6W1F7DJ2D |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D00198 |
| KEGG = D00198 |
||
| ChEBI_Ref = {{ebicite| |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
||
| ChEBI = 28572 |
| ChEBI = 28572 |
||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
||
| ChEMBL = 1668 |
| ChEMBL = 1668 |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=35 | H=42 | N=2 | O=9 |
| C=35 | H=42 | N=2 | O=9 |
||
| smiles = [H][C@]26C[C@@H](OC(=O)/C=C/c1cc(OC)c(OC)c(OC)c1)[C@H](OC)[C@@H](C(=O)OC)[C@@]2([H])C[C@]5([H])c4[nH]c3cc(OC)ccc3c4CCN5C6 |
|||
| molecular_weight = 634.716 g/mol |
|||
| smiles = O=C(OC)[C@H]6[C@H]4C[C@@H]3c2nc1cc(OC)ccc1c2CCN3C[C@H]4C[C@@H](OC(=O)\C=C\c5cc(OC)c(OC)c(OC)c5)[C@@H]6OC |
|||
| InChI = 1/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1 |
|||
| InChIKey = SZLZWPPUNLXJEA-QEGASFHIBN |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1 |
| StdInChI = 1S/C35H42N2O9/c1-40-21-8-9-22-23-11-12-37-18-20-15-29(46-30(38)10-7-19-13-27(41-2)33(43-4)28(14-19)42-3)34(44-5)31(35(39)45-6)24(20)17-26(37)32(23)36-25(22)16-21/h7-10,13-14,16,20,24,26,29,31,34,36H,11-12,15,17-18H2,1-6H3/b10-7+/t20-,24+,26-,29-,31+,34+/m1/s1 |
||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = SZLZWPPUNLXJEA-QEGASFHISA-N |
| StdInChIKey = SZLZWPPUNLXJEA-QEGASFHISA-N |
||
| synonyms = <small>methyl (1''R'',15''S'',17''R'',18''R'',19''S'',20''S'')-6,18-dimethoxy-17-{[(2''E'')-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy}-3,13-diazapentacyclo[11.8.0.0<sup>2,10</sup>.0<sup>4,9</sup>.0<sup>15,20</sup>]henicosa-2(10),4(9),5,7-tetraene-19-carboxylate</small> |
| synonyms = <small>methyl (1''R'',15''S'',17''R'',18''R'',19''S'',20''S'')-6,18-dimethoxy-17-<nowiki/>{[(2''E'')-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy}-3,13-diazapentacyclo[11.8.0.0<sup>2,10</sup>.0<sup>4,9</sup>.0<sup>15,20</sup>]henicosa-2(10),4(9),5,7-tetraene-19-carboxylate</small> |
||
}} |
}} |
||
'''Rescinnamine''', known by the brand names '''''Moderil''''', '''''Cinnasil''''', and '''''Anaprel''''', is an [[ACE inhibitor|angiotensin-converting enzyme inhibitor]] used as an [[antihypertensive]] [[medication|drug]]. |
|||
It is an indoloquinolizine [[alkaloid]] similar to [[reserpine]], obtained from ''[[Rauvolfia serpentina]]''<ref name="pmid13699407">{{cite journal |vauthors=FIFE R, MACLAURIN JC, WRIGHT JH |title=Rescinnamine in treatment of hypertension in hospital clinic and in general practice |journal=British Medical Journal |volume=2 |issue=5216 |pages=1848–50 |date=December 1960 |pmid=13699407 |pmc=2098607 |doi= 10.1136/bmj.2.5216.1848}}</ref> and other [[species]] of ''[[Rauvolfia]]''.<ref>{{cite journal |journal = Planta Med. |year = 1982 |volume = 44 |issue = 2 |pages = 91–3 |title = Alkaloids of Vinca major cv. Variegata. |vauthors = Balsevich J, Constabel F, Kurz WG |pmid = 17402086 |doi=10.1055/s-2007-971409}}</ref> |
|||
== References == |
|||
{{reflist}} |
|||
{{ACE inhibitors}} |
|||
{{Angiotensin receptor modulators}} |
|||
{{Tryptamines}} |
|||
[[Category:Indoloquinolizines]] |
|||
[[Category:Tryptamine alkaloids]] |
|||
[[Category:Isoquinoline alkaloids]] |
|||
[[Category:ACE inhibitors]] |
|||
[[Category:Antihypertensive agents]] |
|||
[[Category:Alkaloids found in Rauvolfia]] |
|||
[[Category:Pyrogallol ethers]] |
|||
[[Category:Cinnamate esters]] |
|||
[[Category:Indole ethers at the benzene ring]] |
|||
[[Category:Heterocyclic compounds with 5 rings]] |
|||
[[Category:Methoxy compounds]] |
|||
[[Category:Methyl esters]] |
|||
{{Antihypertensive-stub}} |