Puerarin: Difference between revisions

{{Refimprove|date=January 2010}}

{{chembox

| Verifiedfields = changed

| verifiedrevid = 414763044

| reference =

| ImageSize = 200px

| IUPACName = 7-hydroxy-3-(4-hydroxyphenyl)-8-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one

| OtherNames = Daidzein-8-C-glucoside<br>7,4'-Dihydroxy-8-C-glucosylisoflavone

| Section1 = {{Chembox Identifiers

| Abbreviations =

| EINECS =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChemSpiderID = 4445119

| SMILES = O=C2c3c(O/C=C2/c1ccc(O)cc1)c(c(O)cc3)[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)CO

| StdInChI=1S/C21H20O9/c22-7-14-17(26)18(27)19(28)21(30-14)15-13(24)6-5-11-16(25)12(8-29-20(11)15)9-1-3-10(23)4-2-9/h1-6,8,14,17-19,21-24,26-28H,7H2/t14-,17-,18+,19-,21+/m1/s1

| ChEBI =

| KEGG =

| ATCCode_prefix =

| ATCCode_suffix =

| ATC_Supplemental =}}

| Section2 = {{Chembox Properties

| Formula = C₂₁H₂₀O₉

| MolarMass = 416.37 g/mol

| ExactMass = 416.110732

| Appearance =

| Density =

| MeltingPt = <!-- °C -->

| Melting_notes =

| BoilingPt =

| Boiling_notes =

| Solubility =

| SolubleOther =

| Solvent =

| pKa =

| pKb = }}

| Section7 = {{Chembox Hazards

| EUClass =

| EUIndex =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-O =

| RPhrases =

| SPhrases =

| RSPhrases =

| FlashPt =

| Autoignition =

| ExploLimits =

| PEL = }}

'''Puerarin''' is one of several known [[isoflavone]]s. Puerarin is found in a number of plants and herbs like the root of ''[[Pueraria]]'' (''Radix puerariae'')<ref>[http://www.sciencedirect.com/science?_ob=ArticleURL&_udi=B6T1J-4KWJY1D-4&_user=10&_coverDate=12%2F15%2F2006&_alid=990228584&_rdoc=24&_fmt=high&_orig=search&_cdi=4892&_docanchor=&view=c&_ct=415&_acct=C000050221&_version=1&_urlVersion=0&_userid=10&md5=4950eeadf9a2a24aeb52eace6853470c Puerarin, an isoflavonoid derived from Radix puerariae, potentiates endothelium-independent relaxation via the cyclic AMP pathway in porcine coronary artery, Dennis K.Y. Yeunga, Susan W.S. Leung, a, , Yan Chun Xua, Paul M. Vanhouttea and Ricky Y.K. Mana, 2006]</ref> notably of the [[kudzu]] plant.

Puerarin is the 8-C-[[glucoside]] of [[daidzein]].

Puerarin is a [[5-HT2C receptor]] and [[benzodiazepine site]] antagonist.<ref>{{Cite journal

| doi = 10.1016/S0091-3057(03)00114-X

| author = Overstreet DH, Kralic JE, Morrow AL, Ma ZZ, Zhang YW, Lee DY

| year = 2003

| title = NPI-031G (puerarin) reduces anxiogenic effects of alcohol withdrawal or benzodiazepine inverse or 5-HT2C agonists.

| journal = [[Pharmacology, biochemistry, and behavior]]

| volume = 75

| issue = 3

| pages = 619–625

| pmid = 12895679

}}</ref>

Puerarin is being investigated as a [[self-microemulsifying drug delivery system]].

<!-- ==Metabolism==

The enzyme [[ -->

<!-- ==Glycosides==

[[]] is the 7-O-[[glucoside]] of Puerarin. -->

* [[Pueraria lobata]] <ref name=isfe>{{cite journal

| last = Wang

| first = Lingzhao ''et al.''

| authorlink =

| coauthors =

| last2 = Yang

| first2 = BAO

| last3 = Du

| first3 = Xiuqiao| title = Investigation of supercritical fluid extraction of puerarin from ''Pueraria Lobata''

| journal = [[Journal of Food Process Engineering]]

| volume = 32

| issue = 5

| pages = 682–691

| publisher = [[John Wiley & Sons]]

| location =

| year = 2009

| url =

| issn =

| doi = 10.1111/j.1745-4530.2007.00238.x

| id =

| accessdate = 29 January 2010}}</ref>^, <ref name=dpdr>{{cite journal

| last = Chen

| first = Gang ''et al.''

| authorlink =

| coauthors =

| last2 = Zhang

| first2 = J

| last3 = Ye

| first3 = J| title = Determination of puerarin, daidzein and rutin in ''Pueraria lobata'' (Wild.) Ohwi by capillary electrophoresis with electrochemical detection

| journal = [[Journal of Chromatography A]]

| volume = 923

| issue = 1 - 2

| pages = 255–262

| publisher = [[Elsevier]]

| location =

| year = 2001

| url =

| issn =

| doi = 10.1016/S0021-9673(01)00996-7

| id =

| accessdate = 29 January 2010

| pmid=11510548}}</ref>

* [[Pueraria phaseoloides]] <ref name=spph>{{cite journal

| last = Kintzios

| first = Spiridon ''et al.''

| authorlink =

| coauthors =

| last2 = Makri

| first2 = Olga

| last3 = Pistola

| first3 = Eleni

| last4 = Matakiadis

| first4 = Theodoros

| last5 = Ping Shi

| first5 = He

| last6 = Economou

| first6 = Athanassios| title = Scale-up production of puerarin from hairy roots of ''Pueraria phaseoloides'' in an airlift bioreactor

| journal = [[Biotechnology Letters]]

| volume = 26

| issue = 13

| pages = 1057–1059

| publisher = [[Springer Science+Business Media|Springer]]

| location =

| year = 2004

| url =

| issn = 0141-5492

| doi = 10.1023/B:BILE.0000032963.41208.e8

| id =

| accessdate = 29 January 2010}}</ref>^, <ref name=gtpp>{{cite journal

| last = Shi

| first = H. P

| authorlink =

| coauthors = S. Kintzies

| title = Genetic transformation of ''Pueraria phaseoloides'' with ''Agrobacterium rhizogenes'' and puerarin production in hairy roots

| journal = [[Plant Cell Reports]]

| volume = 21

| issue = 11

| pages = 1103–1107

| publisher = [[Springer Science+Business Media|Springer]]

| location =

| year = 2003

| url =

| issn = 0721-7714

| doi = 10.1007/s00299-003-0633-6

| id =

| accessdate = 29 January 2010}}</ref> {{Clarify|date=January 2010}}

== Notes & references ==

{{Natural-phenol-stub}}