Jump to content

Oxypertine: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chembox vali
m LTA
 
(47 intermediate revisions by 25 users not shown)
Line 1: Line 1:
{{Short description|Antipsychotic medication}}
{{drugbox
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
⚫
| verifiedrevid = 444739401
⚫
| IUPAC_name = 5,6-Dimethoxy-2-methyl-3-[2-(4-phenylpiperazin-1-yl)ethyl]-1''H''-indole
⚫
| image = Oxypertine.svg
| width = 225

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|oxypertine}}
⚫
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_BR = C1
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=2023-04-04}}</ref>
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_NZ = <!-- Class A, B, C -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_EU =
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
⚫
| legal_status = Rx-only
⚫
| routes_of_administration = [[Oral administration|By mouth]]

<!--Pharmacokinetic data-->
⚫
| bioavailability =
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
⚫
| CAS_number = 153-87-7
⚫
| ATC_prefix = N05
⚫
| ATC_suffix = AE01
⚫
| PubChem = 4640
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5JGL4G25R7
| UNII = 5JGL4G25R7
⚫
| verifiedrevid = 437149958
⚫
| IUPAC_name = 5,6-dimethoxy-2-methyl-3-[2-(4-phenylpiperazin-1-yl)ethyl]-1''H''-indole
⚫
| image = Oxypertine.png
⚫
| CAS_number = 153-87-7
⚫
| ATC_prefix = N05
⚫
| ATC_suffix = AE01
⚫
| PubChem = 4640
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01219
| KEGG = D01219
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| C = 23 | H = 29 | N = 3 | O = 2
| ChemSpiderID = 4479
| molecular_weight = 379.49 g/mol

⚫
| smiles = CC1=C(C2=CC(=C(C=C2N1)OC)OC)CCN3CCN(CC3)C4=CC=CC=C4
<!--Chemical data-->
⚫
| bioavailability =
| metabolism =
| C=23 | H=29 | N=3 | O=2
⚫
| smiles = CC1=C(C2=CC(=C(C=C2N1)OC)OC)CCN3CCN(CC3)C4=CC=CC=C4
⚫
| elimination_half-life =
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
⚫
| excretion =
| StdInChI = 1S/C23H29N3O2/c1-17-19(20-15-22(27-2)23(28-3)16-21(20)24-17)9-10-25-11-13-26(14-12-25)18-7-5-4-6-8-18/h4-8,15-16,24H,9-14H2,1-3H3
⚫
| pregnancy_category =
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
⚫
| legal_status = Rx-only
| StdInChIKey = XCWPUUGSGHNIDZ-UHFFFAOYSA-N
⚫
| routes_of_administration = Oral
}}
}}


'''Oxypertine''' ('''Equipertine''', '''Forit''', '''Integrin''', '''Lanturil''', '''Lotawin''', '''Opertil''') is an [[antipsychotic]] used in the treatment of [[schizophrenia]].<ref name="isbn0-412-54090-8">{{cite book | author = | title = Dictionary of organic compounds | publisher = Chapman & Hall | location = London | year = 1996 | pages = | isbn = 0-412-54090-8 | oclc = | doi = | url = http://books.google.com/?id=5S_uhYzKWisC&lpg=PA5038&dq=oxypertine%20forit&pg=PA5038#v=onepage&q= | author1 = Hall, Chapman and | author2 = Rhodes, P. H}}</ref> Chemically, it is an [[indole]] [[chemical derivative|derivative]] similarly to [[molindone]] and a member of the [[phenylpiperazine]] class.<ref name="pmid4972600">{{cite journal |author=Breulet M, Labar P, Delree C, Collard J, Bobon J |title=[Oxypertine, peperazine derivative of tryptophan with neuroleptic and dynamogenic properties] |language=French |journal=Acta Neurol Psychiatr Belg |volume=68 |issue=2 |pages=116–27 |year=1968 |month=February |pmid=4972600 |doi= |url=}}</ref> Like [[reserpine]] and [[tetrabenazine]], oxypertine depletes [[catecholamine]]s, though not [[serotonin]], possibly underlying its neuroleptic efficacy.<ref name="pmid5362847">{{cite journal | author = Bak IJ, Hassler R, Kim JS | title = Differential monoamine depletion by oxypertine in nerve terminals. Granulated synaptic vesicles in relation to depletion of norepinephrine, dopamine and serotonin | journal = Zeitschrift Für Zellforschung Und Mikroskopische Anatomie (Vienna, Austria : 1948) | volume = 101 | issue = 3 | pages = 448–62 | year = 1969 | pmid = 5362847 | doi = | url = }}</ref>
'''Oxypertine''' ('''Equipertine''', '''Forit''', '''Integrin''', '''Lanturil''', '''Lotawin''', '''Opertil''') is an [[antipsychotic]] used in the treatment of [[schizophrenia]].<ref name="isbn0-412-54090-8">{{cite book | title = Dictionary of organic compounds | publisher = Chapman & Hall | location = London | year = 1996 | isbn = 0-412-54090-8 | url = https://books.google.com/books?id=5S_uhYzKWisC&q=oxypertine%20forit&pg=PA5038 | vauthors = Hall C, Rhodes PH }}</ref> It was also evaluated for the treatment of [[anxiety]] at a dosage of 20&nbsp;mg per day.<ref name="pmid12484">{{cite journal | vauthors = Somohano MD, Broissin MC, Sobrino ZA | title = [Clinical evaluation of oxypertine in anxiety conditions] | language = es | journal = Neurologia, Neurocirugia, Psiquiatria | volume = 17 | issue = 3 | pages = 171–180 | date = 1976 | pmid = 12484 | doi = }}</ref> Chemically, it is an [[indole]] and [[phenylpiperazine]] [[chemical derivative|derivative]].<ref name="pmid4972600">{{cite journal | vauthors = Breulet M, Labar P, Delree C, Collard J, Bobon J | title = [Oxypertine, peperazine derivative of tryptophan with neuroleptic and dynamogenic properties] | language = fr | journal = Acta Neurologica et Psychiatrica Belgica | volume = 68 | issue = 2 | pages = 116–127 | date = February 1968 | pmid = 4972600 }}</ref> Like [[reserpine]] and [[tetrabenazine]], oxypertine depletes [[catecholamine]]s, though not [[serotonin]], possibly underlying its neuroleptic efficacy.<ref name="pmid5362847">{{cite journal | vauthors = Bak IJ, Hassler R, Kim JS | title = Differential monoamine depletion by oxypertine in nerve terminals. Granulated synaptic vesicles in relation to depletion of norepinephrine, dopamine and serotonin | journal = Zeitschrift für Zellforschung und Mikroskopische Anatomie | volume = 101 | issue = 3 | pages = 448–462 | year = 1969 | pmid = 5362847 | doi = 10.1007/BF00335580 | s2cid = 32583722 }}</ref> Its structure is similar to [[solypertine]] and [[milipertine]].


== See also ==
== See also ==
* [[Monoamine-depleting agent]]
* [[Antipsychotic]]


== References ==
== References ==
{{Reflist}}
{{Reflist}}



{{Antipsychotics}}
{{Antipsychotics}}
{{Adrenergics}}
{{Dopaminergics}}
{{Piperazines}}
{{Tryptamines}}
{{Tryptamines}}


[[Category:Piperazines]]
[[Category:Antipsychotics]]
[[Category:Indoles]]
[[Category:Catechol ethers]]
[[Category:Phenol ethers]]
[[Category:Indole ethers at the benzene ring]]
[[Category:Monoamine-depleting agents]]

[[Category:Phenylpiperazines]]
[[Category:Tryptamines]]


{{nervous-system-drug-stub}}
{{Nervous-system-drug-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"