O-806: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
-{{Drugbox| verifiedrevid = 431351054
+{{Drugbox
-|
+| verifiedrevid = 439875164
-|IUPAC_name = (6aR)-3-(6-bromohex-2-ynyl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol
+| IUPAC_name = (6aR)-3-(6-bromohex-2-ynyl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol
-| image = O-806.png
+| image = O-806 Structure.svg
-| width= 240
-| CAS_number=
+| width = 240
-| ATC_prefix=
+<!--Clinical data-->
-| ATC_suffix=
+| tradename =
-| PubChem= 10549140
+| legal_status =
-|  ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
+| routes_of_administration =
+<!--Pharmacokinetic data-->
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number =
+| PubChem = 10549140
+| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 26001356
-|  StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
+<!--Chemical data-->
-| StdInChIKey = QHFROVGTWNPDOW-QZTJIDSGSA-N
+| C=22 | H=27 | Br=1 | O=2
-|  StdInChI_Ref = {{stdinchicite|correct|chemspider}}
-| StdInChI=1S/C22H27BrO2/c1-15-9-10-18-17(12-15)21-19(24)13-16(8-6-4-5-7-11-23)14-20(21)25-22(18,2)3/h9,13-14,17-18,24H,5,7-8,10-12H2,1-3H3/t17-,18-/m1/s1
-| DrugBank=
-| C=22 | H=27 | Br=1 | O=2
-| molecular_weight = 403.352 g/mol
 | smiles = C3C1C(CC=C3C)C(C)(C)Oc(c2)c1c(O)cc2CC#CCCCBr
+| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
-| bioavailability=
+| StdInChI = 1S/C22H27BrO2/c1-15-9-10-18-17(12-15)21-19(24)13-16(8-6-4-5-7-11-23)14-20(21)25-22(18,2)3/h9,13-14,17-18,24H,5,7-8,10-12H2,1-3H3/t17-,18-/m1/s1
-| metabolism =
+| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
-| elimination_half-life=
+| StdInChIKey = QHFROVGTWNPDOW-QZTJIDSGSA-N
-| excretion =
-| pregnancy_category =
-| legal_status =
-| routes_of_administration=
 }}
-'''O-806''' is a drug which is a [[cannabinoid]] derivative that is used in scientific research. It is described as a mixed agonist/antagonist at the cannabinoid [[Receptor (biochemistry)|receptor]] [[cannabinoid receptor 1|CB<sub>1</sub>]], meaning that it acts as an antagonist when co-administered alongside a more potent CB<sub>1</sub> agonist, but exhibits weak partial agonist effects when administered by itself.<ref>{{Cite pmid|10323589}}</ref><ref>{{Cite pmid|10516649}}</ref>
+'''O-806''' is a drug which is a [[cannabinoid]] derivative that is used in scientific research. It is described as a mixed agonist/antagonist at the cannabinoid [[Receptor (biochemistry)|receptor]] [[cannabinoid receptor 1|CB<sub>1</sub>]], meaning that it acts as an antagonist when co-administered alongside a more potent CB<sub>1</sub> agonist, but exhibits weak partial agonist effects when administered by itself.<ref>{{cite journal | vauthors = Griffin G, Wray EJ, Rorrer WK, Crocker PJ, Ryan WJ, Saha B, Razdan RK, Martin BR, Abood ME | display-authors = 6 | title = An investigation into the structural determinants of cannabinoid receptor ligand efficacy | journal = British Journal of Pharmacology | volume = 126 | issue = 7 | pages = 1575–84 | date = April 1999 | pmid = 10323589 | pmc = 1565939 | doi = 10.1038/sj.bjp.0702469 }}</ref><ref>{{cite journal | vauthors = Griffin G, Wray EJ, Martin BR, Abood ME | title = Cannabinoid agonists and antagonists discriminated by receptor binding in rat cerebellum | journal = British Journal of Pharmacology | volume = 128 | issue = 3 | pages = 684–8 | date = October 1999 | pmid = 10516649 | pmc = 1571656 | doi = 10.1038/sj.bjp.0702806 }}</ref>
-==References==
+== References ==
 {{reflist}}
@@ Line 37: / Line 41: @@
 [[Category:Benzochromenes]]
 [[Category:Phenols]]
-[[Category:Alkynes]]
+[[Category:Alkyne derivatives]]
 [[Category:Organobromides]]
 {{cannabinoid-stub}}