O-806: Difference between revisions
Appearance
Content deleted Content added
→References: clean up and general fixes using AWB (7774) |
Importing Wikidata short description: "Chemical compound" (Shortdesc helper) |
||
(7 intermediate revisions by 7 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
⚫ | |||
{{Drugbox |
|||
| |
|||
⚫ | |||
|IUPAC_name = (6aR)-3-(6-bromohex-2-ynyl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| IUPAC_name = (6aR)-3-(6-bromohex-2-ynyl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
||
| image = O-806. |
| image = O-806 Structure.svg |
||
| width= 240 |
|||
| |
| width = 240 |
||
| ATC_prefix= |
|||
<!--Clinical data--> |
|||
| ATC_suffix= |
|||
| tradename = |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
| CAS_number = |
|||
⚫ | |||
⚫ | |||
| ChemSpiderID = 26001356 |
| ChemSpiderID = 26001356 |
||
⚫ | |||
<!--Chemical data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| DrugBank= |
|||
⚫ | |||
| molecular_weight = 403.352 g/mol |
|||
| smiles = C3C1C(CC=C3C)C(C)(C)Oc(c2)c1c(O)cc2CC#CCCCBr |
| smiles = C3C1C(CC=C3C)C(C)(C)Oc(c2)c1c(O)cc2CC#CCCCBr |
||
⚫ | |||
| bioavailability= |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| pregnancy_category = |
|||
⚫ | |||
⚫ | |||
}} |
}} |
||
'''O-806''' is a drug which is a [[cannabinoid]] derivative that is used in scientific research. It is described as a mixed agonist/antagonist at the cannabinoid [[Receptor (biochemistry)|receptor]] [[cannabinoid receptor 1|CB<sub>1</sub>]], meaning that it acts as an antagonist when co-administered alongside a more potent CB<sub>1</sub> agonist, but exhibits weak partial agonist effects when administered by itself.<ref>{{ |
'''O-806''' is a drug which is a [[cannabinoid]] derivative that is used in scientific research. It is described as a mixed agonist/antagonist at the cannabinoid [[Receptor (biochemistry)|receptor]] [[cannabinoid receptor 1|CB<sub>1</sub>]], meaning that it acts as an antagonist when co-administered alongside a more potent CB<sub>1</sub> agonist, but exhibits weak partial agonist effects when administered by itself.<ref>{{cite journal | vauthors = Griffin G, Wray EJ, Rorrer WK, Crocker PJ, Ryan WJ, Saha B, Razdan RK, Martin BR, Abood ME | display-authors = 6 | title = An investigation into the structural determinants of cannabinoid receptor ligand efficacy | journal = British Journal of Pharmacology | volume = 126 | issue = 7 | pages = 1575–84 | date = April 1999 | pmid = 10323589 | pmc = 1565939 | doi = 10.1038/sj.bjp.0702469 }}</ref><ref>{{cite journal | vauthors = Griffin G, Wray EJ, Martin BR, Abood ME | title = Cannabinoid agonists and antagonists discriminated by receptor binding in rat cerebellum | journal = British Journal of Pharmacology | volume = 128 | issue = 3 | pages = 684–8 | date = October 1999 | pmid = 10516649 | pmc = 1571656 | doi = 10.1038/sj.bjp.0702806 }}</ref> |
||
==References== |
== References == |
||
{{reflist}} |
{{reflist}} |
||
Line 37: | Line 41: | ||
[[Category:Benzochromenes]] |
[[Category:Benzochromenes]] |
||
[[Category:Phenols]] |
[[Category:Phenols]] |
||
[[Category: |
[[Category:Alkyne derivatives]] |
||
[[Category:Organobromides]] |
[[Category:Organobromides]] |
||
{{cannabinoid-stub}} |
{{cannabinoid-stub}} |