Jump to content

NBUMP: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (
Importing Wikidata short description: "Chemical compound"
 
(15 intermediate revisions by 14 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| verifiedrevid = 352865559
| verifiedrevid = 424813377
| IUPAC_name = ''N''-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]adamantane-1-carboxamide
| IUPAC_name = ''N''-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]adamantane-1-carboxamide
| image = NBUMP.png
| image = NBUMP.png

| CAS_number = ?
<!--Clinical data-->
⚫
| ATC_prefix = none
| tradename =
⚫
| ATC_suffix =
⚫
| pregnancy_category =
⚫
| PubChem = 64622
⚫
| legal_status =
⚫
| C = 26 | H = 39 | N = 3 | O = 2
⚫
| routes_of_administration =
| molecular_weight = 425.607 g/mol

| smiles =
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =
⚫
| pregnancy_category =

⚫
| legal_status =
<!--Identifiers-->
⚫
| routes_of_administration =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 134390-72-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = G184WXO36J
⚫
| ATC_prefix = none
⚫
| ATC_suffix =
⚫
| PubChem = 64622
| ChemSpiderID = 58183

<!--Chemical data-->
⚫
| C=26 | H=39 | N=3 | O=2
| smiles = COc1ccccc1N2CCN(CC2)CCCCNC(=O)C34CC5CC(C3)CC(C5)C4
| StdInChI = 1S/C26H39N3O2/c1-31-24-7-3-2-6-23(24)29-12-10-28(11-13-29)9-5-4-8-27-25(30)26-17-20-14-21(18-26)16-22(15-20)19-26/h2-3,6-7,20-22H,4-5,8-19H2,1H3,(H,27,30)
| StdInChIKey = PRZPXKIXNNNNCD-UHFFFAOYSA-N
}}
}}


'''NBUMP''' is a highly [[binding selectivity|selective]] [[5-HT1A receptor|5-HT<sub>1A</sub> receptor]] [[partial agonist]] (K<sub>i</sub> = 0.1 nM; IA = 40%) with an [[aryl]][[piperazine]] structure.<ref name="isbn1-58829-568-0">{{cite book | author = Roth, Bryan L. | title = The Serotonin Receptors: From Molecular Pharmacology to Human Therapeutics (The Receptors) | publisher = Humana Press | location = Totowa, NJ | year = 2006 | pages = | isbn = 1-58829-568-0 | oclc = | doi = | url = http://books.google.com/books?id=J6i6YpvCQfIC&lpg=PA140&ots=83um2AK2-u&dq=4-%5B4-(1-noradamantane%20carboxamido)butyl%5D-1-(2-methoxyphenyl)piperazine%20-%20A%20high%20affinity%205-HT1A-selective%20agent&pg=PA113#v=onepage&q=NBUMP&f=false}}</ref> It is one of the highest [[affinity (pharmacology)|affinity]] ligands for the 5-HT<sub>1A</sub> receptor known.<ref name="isbn1-58829-568-0">{{cite book | author = Roth, Bryan L. | title = The Serotonin Receptors: From Molecular Pharmacology to Human Therapeutics (The Receptors) | publisher = Humana Press | location = Totowa, NJ | year = 2006 | pages = | isbn = 1-58829-568-0 | oclc = | doi = | url = http://books.google.com/books?id=J6i6YpvCQfIC&lpg=PA140&ots=83um2AK2-u&dq=4-%5B4-(1-noradamantane%20carboxamido)butyl%5D-1-(2-methoxyphenyl)piperazine%20-%20A%20high%20affinity%205-HT1A-selective%20agent&pg=PA113#v=onepage&q=NBUMP&f=false}}</ref> It displays 460- and 260-fold selectivity for 5-HT<sub>1A</sub> over the [[alpha-1 adrenergic receptor|α<sub>1</sub>-adrenergic]] and [[D2 receptor|D<sub>2</sub> receptor]]s, respectively.<ref name="isbn1-58829-568-0">{{cite book | author = Roth, Bryan L. | title = The Serotonin Receptors: From Molecular Pharmacology to Human Therapeutics (The Receptors) | publisher = Humana Press | location = Totowa, NJ | year = 2006 | pages = | isbn = 1-58829-568-0 | oclc = | doi = | url = http://books.google.com/books?id=J6i6YpvCQfIC&lpg=PA140&ots=83um2AK2-u&dq=4-%5B4-(1-noradamantane%20carboxamido)butyl%5D-1-(2-methoxyphenyl)piperazine%20-%20A%20high%20affinity%205-HT1A-selective%20agent&pg=PA113#v=onepage&q=NBUMP&f=false}}</ref>
'''NBUMP''' is a highly [[binding selectivity|selective]] [[5-HT1A receptor|5-HT<sub>1A</sub> receptor]] [[partial agonist]] (K<sub>i</sub> = 0.1 nM; IA = 40%) with an [[aryl]][[piperazine]] structure.<ref name="isbn1-58829-568-0">{{cite book | vauthors = Glennon RA | chapter = Strategies for the development of selective serotonergic agents|editor1-link=Bryan Roth | veditors = Roth BL | title = The Serotonin Receptors: From Molecular Pharmacology to Human Therapeutics (The Receptors) | publisher = Humana Press | location = Totowa, NJ | year = 2006 | isbn = 1-58829-568-0 | chapter-url = https://books.google.com/books?id=J6i6YpvCQfIC&q=NBUMP&pg=PA113 | page = 113 }}</ref> It is one of the highest [[affinity (pharmacology)|affinity]] ligands for the 5-HT<sub>1A</sub> receptor known.<ref name="isbn1-58829-568-0" /> It displays 460- and 260-fold selectivity for 5-HT<sub>1A</sub> over the [[alpha-1 adrenergic receptor|α<sub>1</sub>-adrenergic]] and [[D2 receptor|D<sub>2</sub> receptor]]s, respectively.<ref name="isbn1-58829-568-0" />


== See also ==
== See also ==
Line 26: Line 41:
== References ==
== References ==
{{Reflist}}
{{Reflist}}



{{Serotonergics}}
{{Serotonergics}}
{{Piperazines}}
{{Piperazines}}


[[Category:Piperazines]]
[[Category:Phenylpiperazines]]
[[Category:5-HT1A agonists]]
[[Category:5-HT1A agonists]]
[[Category:Serotonin receptor agonists]]
[[Category:Serotonin receptor agonists]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"