Maltotriose: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{Refimprove|date=November 2006}}
 {{Chembox
-| verifiedrevid = 443932053
+| verifiedrevid  = 443933810
+| Name           =
-| ImageFile = Maltotriose.svg
+| ImageFile      = Maltotriose.svg
-| ImageSize =
+| ImageSize      =
-| ImageName = Maltotriose
+| ImageName      = Maltotriose
-| IUPACName =
+| IUPACName      = α-<small>D</small>-Glucopyranosyl-(1→4)-α-<small>D</small>-glucopyranosyl-(1→4)-<small>D</small>-glucopyranose
-| OtherNames =
+| OtherNames     =
-| Section1 = {{Chembox Identifiers
+| SystematicName = (2R,3S,4S,5S,6R)-2-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4S,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
+| Section1       = {{Chembox Identifiers
 | InChI = 1/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16u,17-,18-/m1/s1
 | InChIKey = FYGDTMLNYKFZSV-LALNNVAPBU
@@ Line 14: / Line 16: @@
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = FYGDTMLNYKFZSV-DZOUCCHMSA-N
+| CASNo_Ref = {{cascite|correct|CAS}}
 | CASNo = 1109-28-0
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = 639K0T34IK
 | PubChem = 192826
 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
@@ Line 22: / Line 27: @@
 | SMILES = O[C@@H]3[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]3O[C@@H]2[C@@H](CO)O[C@H](O[C@H]1[C@H](O)[C@@H](O)C(O)O[C@@H]1CO)[C@H](O)[C@H]2O
 }}
-| Section2 = {{Chembox Properties
+| Section2       = {{Chembox Properties
 | Formula = C<sub>18</sub>H<sub>32</sub>O<sub>16</sub>
-| MolarMass = 504.437 g/mol
+| MolarMass = 504.438 g/mol
 | Appearance =
 | Density =
@@ Line 30: / Line 35: @@
 | BoilingPt =
 | Solubility = }}
-| Section3 = {{Chembox Hazards
+| Section3       = {{Chembox Hazards
 | MainHazards =
 | FlashPt =
-| Autoignition = }}
+| AutoignitionPt = }}
+| Section4       =
+| Section5       =
+| Section6       =
 }}
-'''Maltotriose''' is a [[trisaccharide]] (three-part sugar) consisting of three [[glucose]] molecules linked with α-1,4 [[glycosidic bond]]s.
+'''Maltotriose''' is a [[trisaccharide]] (three-part sugar) consisting of three [[glucose]] molecules linked with α-1,4 [[glycosidic bond]]s.<ref>{{Cite book | author = Rhoades, Rodney and David R. Bell | title = Medical Physiology: Principles for Clinical Medicine | date = 2009 | publisher = Lippincott Williams & Wilkins | isbn = 978-0781768528}}</ref>
-It is most commonly produced by the digestive enzyme alpha-[[amylase]] (a common enzyme in human [[saliva]]) on [[amylose]] in [[starch]].  The creation of both maltrotriose and [[maltose]] during this process<ref>http://atkinszone.com/low-carb/2009/01/glucose-starches-glycemic-index.html</ref> is due to the random manner in which alpha amylase [[hydrolyses]] α-1,4 [[glycosidic bond]]s.
+It is most commonly produced by the digestive enzyme alpha-[[amylase]] (a common enzyme in human [[saliva]]) on [[amylose]] in [[starch]].  The creation of both maltotriose and [[maltose]] during this process is due to the random manner in which alpha amylase [[hydrolyses]] α-1,4 [[glycosidic bond]]s.
+It is the shortest chain [[oligosaccharide]] that can be classified as [[maltodextrin]].
-==See also==
-* [[Glucose]]
-* [[Maltose]]
 ==References==
 {{Reflist}}
 {{Carbohydrates}}
 [[Category:Trisaccharides]]
+[[Category:Types of sugar]]
 {{Organic-compound-stub}}
-[[es:Maltotriosa]]
-[[fr:Maltotriose]]
-[[hu:Maltotrióz]]
-[[nl:Maltotriose]]
-[[ja:マルトトリオース]]
-[[zh:麦芽三糖]]