Jump to content

MEE (psychedelic): Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi
Changing short description from "organic compound, 2-methoxy-4,5-diethoxyamphetamine" to "Amphetamine drug"
 
(15 intermediate revisions by 14 users not shown)
Line 1: Line 1:
{{Short description|Amphetamine drug}}
{{One source|date=June 2019}}
{{chembox
{{chembox
| Name = MEE
| verifiedrevid = 400292910
| verifiedrevid = 400293834
| ImageFile = MEE.png
| ImageFile = MEE.svg
| ImageSize = 200px
| ImageSize = 200px
| IUPACName = 2-(4,5-Diethoxy-2-methoxy-phenyl)-1-methyl-ethylamine
| PIN = 1-(4,5-Diethoxy-2-methoxyphenyl)propan-2-amine
| OtherNames = 2-Methoxy-4,5-diethoxyphenethylamine
| OtherNames = 2-Methoxy-4,5-diethoxyphenethylamine
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| InChI = 1/C14H23NO3/c1-5-17-13-8-11(7-10(3)15)12(16-4)9-14(13)18-6-2/h8-10H,5-7,15H2,1-4H3
| InChI = 1/C14H23NO3/c1-5-17-13-8-11(7-10(3)15)12(16-4)9-14(13)18-6-2/h8-10H,5-7,15H2,1-4H3
| InChIKey = LKJRFMXILZHUHU-UHFFFAOYAA
| InChIKey = LKJRFMXILZHUHU-UHFFFAOYAA
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 12: Line 15:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LKJRFMXILZHUHU-UHFFFAOYSA-N
| StdInChIKey = LKJRFMXILZHUHU-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 23693-35-8
| CASNo = 23693-35-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ZD2KJL8HG7
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID=21106337
| ChemSpiderID=21106337
| PubChem =
| PubChem = 44719591
| SMILES = CCOc1cc(OC)c(cc1OCC)CC(C)N
| DTXSID = DTXSID30660373
| SMILES = CCOc1cc(OC)c(cc1OCC)CC(C)N
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=14
| Formula = C<sub>14</sub>H<sub>23</sub>NO<sub>3</sub>
| H=23
| MolarMass = 253.34
| Appearance =
| N=1
| O=3
| Appearance =
| Density =
| Density =
| MeltingPt =
| MeltingPt =
| BoilingPt =
| BoilingPt =
| Solubility =
| Solubility =
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
}}
}}
}}
}}


'''MEE''', or 2-[[methoxy]]-4,5-di[[ethoxy]][[amphetamine]], is a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]]. It is a diethoxy-methoxy [[analog (chemistry)|analog]] of [[Trimethoxyamphetamine|TMA-2]]. MEE was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL|PiHKAL (Phenethylamines i Have Known And Loved)]]'', both the dosage and duration are unknown. MEE produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MEE.
'''MEE''' ('''2-methoxy-4,5-diethoxyamphetamine''') is a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]] of the [[substituted amphetamine|amphetamine class]]. It is a diethoxy-methoxy [[analog (chemistry)|analog]] of [[Trimethoxyamphetamine|TMA-2]]. MEE was first synthesized by [[Alexander Shulgin]]. In his book ''[[PiHKAL]]'', both the dosage and duration are unknown.<ref>[http://www.erowid.org/library/books_online/pihkal/pihkal121.shtml MEE entry in ''PiHKAL'']</ref> MEE produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MEE.


== See also ==
== See also ==
Line 40: Line 49:
* [[Psychedelics, dissociatives and deliriants]]
* [[Psychedelics, dissociatives and deliriants]]


== External links ==
== References==
{{reflist}}
* [http://www.erowid.org/library/books_online/pihkal/pihkal121.shtml MEE entry in ''PiHKAL'']
* [http://pihkal.info/read.php?domain=pk&id=121 MEE entry in PiHKAL • info]


[[Category:Substituted amphetamines]]
{{PiHKAL}}


[[Category:Amphetamines]]


{{Psychoactive-stub}}
{{Psychoactive-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"