Jump to content

Furfenorex: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[
 
(22 intermediate revisions by 18 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
⚫
| verifiedrevid = 444928135
⚫
| IUPAC_name = (''RS'')-''N''-(furan-2-ylmethyl)-''N''-methyl-1-phenylpropan-2-amine
⚫
| image = Furfenorex.svg

<!--Clinical data-->
| tradename =
⚫
| pregnancy_category =
⚫
| legal_status =
⚫
| routes_of_administration =

<!--Pharmacokinetic data-->
⚫
| bioavailability =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =

<!--Identifiers-->
| index2_label = (+/-)-
| CAS_number_Ref = {{cascite|correct|CAS}}
⚫
| CAS_number = 3776-93-0
| CAS_number2_Ref = {{cascite|correct|CAS}}
| CAS_number2 = 13445-60-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = X83CZ0Y5TF
| UNII = X83CZ0Y5TF
| UNII2_Ref = {{fdacite|correct|FDA}}
⚫
| verifiedrevid = 437204830
| UNII2 = 554JE75W4N
⚫
| IUPAC_name = (''RS'')-''N''-(furan-2-ylmethyl)-''N''-methyl-1-phenylpropan-2-amine
⚫
| ATC_prefix = none
⚫
| image = Furfenorex.svg
⚫
| ATC_suffix =
⚫
| PubChem = 26762
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 24935
| ChemSpiderID = 24935
| ChEMBL = 2107558
| InChI = 1/C15H19NO/c1-13(11-14-7-4-3-5-8-14)16(2)12-15-9-6-10-17-15/h3-10,13H,11-12H2,1-2H3

| InChIKey = DLGIIZAHQPTVCJ-UHFFFAOYAD
<!--Chemical data-->
⚫
| C=15 | H=19 | N=1 | O=1
| smiles = o1c(ccc1)CN(C(C)Cc2ccccc2)C
| smiles = o1c(ccc1)CN(C(C)Cc2ccccc2)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 14: Line 41:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DLGIIZAHQPTVCJ-UHFFFAOYSA-N
| StdInChIKey = DLGIIZAHQPTVCJ-UHFFFAOYSA-N
⚫
| CAS_number = 13445-60-8
⚫
| ATC_prefix = none
⚫
| ATC_suffix =
⚫
| PubChem = 26762
⚫
| C = 15 | H = 19 | N = 1 | O = 1
| molecular_weight = 229.317 g/mol
⚫
| bioavailability =
⚫
| metabolism =
⚫
| elimination_half-life =
⚫
| excretion =
⚫
| pregnancy_category =
⚫
| legal_status =
⚫
| routes_of_administration =
}}
}}


'''Furfenorex''' ('''Frugalan'''), also known as '''furfurylmethylamphetamine''', is a [[stimulant]] [[drug]] which was developed in the 1960s and used as an [[appetite suppressant]].<ref>{{cite journal | last1 = Boissier | first1 = JR | last2 = Dumont | first2 = C | last3 = Ratouis | first3 = R | last4 = Moisy | first4 = D | title = Pharmacologic study of an anorexigenic agent: furfenorex | journal = Archives internationales de pharmacodynamie et de therapie | volume = 167 | issue = 1 | pages = 150–62 | year = 1967 | pmid = 6035092 }}</ref> It produces [[methamphetamine]] as a [[metabolite]],<ref>{{cite journal | last1 = Marsel | first1 = J | last2 = Döring | first2 = G | last3 = Remberg | first3 = G | last4 = Spiteller | first4 = G | title = Methamphetamine--a metabolite of the anorectics Benzphetamine and Furfenorex | journal = Zeitschrift fur Rechtsmedizin. Journal of legal medicine | volume = 70 | issue = 4 | pages = 245–50 | year = 1972 | pmid = 5084766 }}</ref> and is no longer marketed, due to possible problems with [[drug abuse|abuse]].
'''Furfenorex''' ('''Frugalan'''), also known as '''furfurylmethylamphetamine''', is a [[stimulant]] [[drug]] which was developed in the 1960s and used as an [[appetite suppressant]].<ref>{{cite journal | vauthors = Boissier JR, Dumont C, Ratouis R, Moisy D | title = [Pharmacologic study of an anorexigenic agent: furfenorex] | journal = Archives Internationales de Pharmacodynamie et de Thérapie | volume = 167 | issue = 1 | pages = 150–62 | date = May 1967 | pmid = 6035092 }}</ref> It produces [[methamphetamine]] as a [[metabolite]],<ref>{{cite journal | vauthors = Marsel J, Döring G, Remberg G, Spiteller G | title = [Methamphetamine--a metabolite of the anorectics Benzphetamine and Furfenorex] | journal = Zeitschrift für Rechtsmedizin. Journal of Legal Medicine | volume = 70 | issue = 4 | pages = 245–50 | year = 1972 | pmid = 5084766 | doi = 10.1007/BF02079690 | s2cid = 32585009 }}</ref> and has been withdrawn from the market due to [[drug abuse|abuse potential]].<ref>{{cite book |last1=Daspaguta |first1=Amitava | name-list-style = vanc |title=A Health Educator's Guide to Understanding Drugs of Abuse Testing |date=March 2009 |publisher=Jones & Bartlett Publishers |location=Sudbury, Massachusetts |isbn=9780763765897 |edition=1 |url=https://books.google.com/books?id=R-MkYr2c6o0C&pg=PT358 |access-date=11 December 2019}}</ref>


== References ==
== References ==
Line 36: Line 50:
{{Stimulants}}
{{Stimulants}}
{{Anorectics}}
{{Anorectics}}
{{Monoamine releasing agents}}
{{Adrenergics}}
{{Dopaminergics}}
{{Phenethylamines}}
{{Phenethylamines}}


[[Category:Amphetamines]]
[[Category:Substituted amphetamines]]
[[Category:Anorectics]]
[[Category:Anorectics]]
[[Category:Furans]]
[[Category:2-Furyl compounds]]
[[Category:Norepinephrine-dopamine releasing agents]]



⚫
{{gastrointestinal-drug-stub}}


⚫
{{nervous-system-drug-stub}}
[[de:Furfenorex]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"