Jump to content

Ditazole: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
Ditazole.svg
Importing Wikidata short description: "Chemical compound"
 
(13 intermediate revisions by 11 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| Watchedfields = changed
| verifiedrevid = 443728625
| verifiedrevid = 447915856
| IUPAC_name = 2,2'-(4,5-Diphenyloxazol-2-ylazanediyl)diethanol
| IUPAC_name = 2,2'-(4,5-Diphenyloxazol-2-ylazanediyl)diethanol
| image = Ditazole.svg
| image = Ditazole.svg
Line 26: Line 28:


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 18471-20-0
| CAS_number = 18471-20-0
| ATC_prefix = B01
| ATC_prefix = B01
| ATC_suffix = AC01
| ATC_suffix = AC01
| PubChem = 29088
| PubChem = 29088
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank =
| DrugBank = DB08994
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = H2BQI5Z8FT
| UNII = H2BQI5Z8FT
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07138
| KEGG = D07138
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 27061


<!--Chemical data-->
<!--Chemical data-->
| C=19 | H=20 | N=2 | O=3
| C=19 | H=20 | N=2 | O=3
| smiles = C1=CC=C(C=C1)C2=C(OC(=N2)N(CCO)CCO)C3=CC=CC=C3
| molecular_weight = 324.374 g/mol
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C19H20N2O3/c22-13-11-21(12-14-23)19-20-17(15-7-3-1-4-8-15)18(24-19)16-9-5-2-6-10-16/h1-10,22-23H,11-14H2
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = UUCMDZWCRNZCOY-UHFFFAOYSA-N
}}
}}
'''Ditazole''' is a [[platelet]] aggregation [[Antiplatelet drug|inhibitor]]. It is marketed in [[Spain]] and [[Portugal]] under the trade name '''Ageroplas'''.<ref>[http://www.medicinescomplete.com/mc/martindale/current/2639-d.htm Martindale's Complete Drug Reference]</ref><ref>The Merck Index, 12th Edition. 3432</ref>
'''Ditazole''' is a non-steroidal anti-inflammatory agent with analgesic and antipyretic activity similar to phenylbutazone.<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/Ditazole|title = Ditazole | work = PubChem | publisher = U.S. National Library of Medicine }}</ref> It is also a [[platelet]] aggregation [[Antiplatelet drug|inhibitor]] which is marketed in [[Spain]] and [[Portugal]] under the trade name '''Ageroplas'''.<ref>{{cite book |title=The Merck index : an encyclopedia of chemicals, drugs, and biologicals |date=1996 |publisher=Merck |location=Whitehouse Station, NJ |isbn=978-0-911910-12-4 |edition=12th | id = 3432 | vauthors = Budavari S, O'Neil M, Smith A, Heckelman P, Obenchain J }}</ref>


== References ==
== References ==
Line 47: Line 56:


{{Antithrombotics}}
{{Antithrombotics}}



[[Category:Oxazoles]]
[[Category:Oxazoles]]
[[Category:Antiplatelet drugs]]
[[Category:Antiplatelet drugs]]
[[Category:Amines]]
[[Category:Ethanolamines]]



{{blood-drug-stub}}
{{blood-drug-stub}}

[[hu:Ditazol]]
[[pt:Ditazol]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"