Ditazole: Difference between revisions
Appearance
Content deleted Content added
Ditazole.svg |
Entranced98 (talk | contribs) Importing Wikidata short description: "Chemical compound" |
||
(13 intermediate revisions by 11 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 447915856 |
||
| IUPAC_name = 2,2'-(4,5-Diphenyloxazol-2-ylazanediyl)diethanol |
| IUPAC_name = 2,2'-(4,5-Diphenyloxazol-2-ylazanediyl)diethanol |
||
| image = Ditazole.svg |
| image = Ditazole.svg |
||
Line 26: | Line 28: | ||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 18471-20-0 |
| CAS_number = 18471-20-0 |
||
| ATC_prefix = B01 |
| ATC_prefix = B01 |
||
| ATC_suffix = AC01 |
| ATC_suffix = AC01 |
||
| PubChem = 29088 |
| PubChem = 29088 |
||
| DrugBank_Ref = {{drugbankcite| |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
||
| DrugBank = |
| DrugBank = DB08994 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = H2BQI5Z8FT |
| UNII = H2BQI5Z8FT |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D07138 |
| KEGG = D07138 |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 27061 |
|||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=19 | H=20 | N=2 | O=3 |
| C=19 | H=20 | N=2 | O=3 |
||
| smiles = C1=CC=C(C=C1)C2=C(OC(=N2)N(CCO)CCO)C3=CC=CC=C3 |
|||
| molecular_weight = 324.374 g/mol |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C19H20N2O3/c22-13-11-21(12-14-23)19-20-17(15-7-3-1-4-8-15)18(24-19)16-9-5-2-6-10-16/h1-10,22-23H,11-14H2 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = UUCMDZWCRNZCOY-UHFFFAOYSA-N |
|||
}} |
}} |
||
'''Ditazole''' is a [[platelet]] aggregation [[Antiplatelet drug|inhibitor]] |
'''Ditazole''' is a non-steroidal anti-inflammatory agent with analgesic and antipyretic activity similar to phenylbutazone.<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/Ditazole|title = Ditazole | work = PubChem | publisher = U.S. National Library of Medicine }}</ref> It is also a [[platelet]] aggregation [[Antiplatelet drug|inhibitor]] which is marketed in [[Spain]] and [[Portugal]] under the trade name '''Ageroplas'''.<ref>{{cite book |title=The Merck index : an encyclopedia of chemicals, drugs, and biologicals |date=1996 |publisher=Merck |location=Whitehouse Station, NJ |isbn=978-0-911910-12-4 |edition=12th | id = 3432 | vauthors = Budavari S, O'Neil M, Smith A, Heckelman P, Obenchain J }}</ref> |
||
== References == |
== References == |
||
Line 47: | Line 56: | ||
{{Antithrombotics}} |
{{Antithrombotics}} |
||
[[Category:Oxazoles]] |
[[Category:Oxazoles]] |
||
[[Category:Antiplatelet drugs]] |
[[Category:Antiplatelet drugs]] |
||
[[Category: |
[[Category:Ethanolamines]] |
||
{{blood-drug-stub}} |
{{blood-drug-stub}} |
||
[[hu:Ditazol]] |
|||
[[pt:Ditazol]] |