Jump to content

Dimefline: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation
Importing Wikidata short description: "Chemical compound"
 
(22 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
⚫
| verifiedrevid = 444451416
⚫
| IUPAC_name = 8-(dimethylaminomethyl)-7-methoxy-3-methyl-2-phenylchromen-4-one
⚫
| image = Dimefline.svg

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|dimefline}}
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category =
⚫
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
⚫
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status =
⚫
| routes_of_administration =

<!--Pharmacokinetic data-->
⚫
| bioavailability =
⚫
| protein_bound =
⚫
| metabolism =
⚫
| elimination_half-life =
| excretion =

<!--Identifiers-->
⚫
| CAS_number = 1165-48-6
⚫
| ATC_prefix = R07
⚫
| ATC_suffix = AB08
⚫
| PubChem = 3078
⚫
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank =
| ChEMBL = 519364
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9WII5M0DU3
| UNII = 9WII5M0DU3
⚫
| verifiedrevid = 443334251
⚫
| IUPAC_name = 8-(dimethylaminomethyl)-7-methoxy-3-methyl-2-phenylchromen-4-one
⚫
| image = Dimefline.svg
⚫
| CAS_number = 1165-48-6
⚫
| ATC_prefix = R07
⚫
| ATC_suffix = AB08
⚫
| PubChem = 3078
⚫
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07847
| KEGG = D07847
| ChemSpiderID = 2969
| C=20 | H=21 | N=1 | O=3
| smiles = O=C\1c3c(O/C(=C/1C)c2ccccc2)c(c(OC)cc3)CN(C)C
| molecular_weight = 323.38564 g/mol
| StdInChI = 1S/C20H21NO3/c1-13-18(22)15-10-11-17(23-4)16(12-21(2)3)20(15)24-19(13)14-8-6-5-7-9-14/h5-11H,12H2,1-4H3
⚫
| bioavailability =
| StdInChIKey = ZXFQRFXLFWWKLX-UHFFFAOYSA-N
⚫
| protein_bound =

⚫
| metabolism =
<!--Chemical data-->
⚫
| elimination_half-life =
| excretion =
| C=20 | H=21 | N=1 | O=3
⚫
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫
| pregnancy_US = <!-- A / B / C / D / X -->
⚫
| pregnancy_category=
⚫
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
⚫
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
⚫
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫
| legal_status =
⚫
| routes_of_administration =
}}
}}
'''Dimefline''' is a respiratory stimulant.<ref>{{cite book | vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms |date=1999 |publisher=Springer Netherlands |location=Dordrecht |isbn=9789401144391 | page = 100 | chapter = Dimefline | chapter-url = https://books.google.com/books?id=tsjrCAAAQBAJ&dq=Dimefline&pg=PA100 }}</ref>
'''Dimefline''' is a [[respiratory stimulant]].


== References ==
⚫
{{Other respiratory system products}}
{{reflist}}

⚫
[[Category:Respiratory agents]]
⚫
[[Category:Flavonoid drugs]]
⚫
[[Category:Phenol ethers]]


⚫
{{Other respiratory system products}}
{{respiratory-system-drug-stub}}
{{respiratory-system-drug-stub}}
⚫
[[Category:Respiratory agents]]

⚫
[[Category:Resorcinol ethers]]
[[zh:二甲弗林]]
⚫
[[Category:Flavones]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"