Clopamide: Difference between revisions
Appearance
Content deleted Content added
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot |
m Moving Category:Novartis brands to Category:Drugs developed by Novartis per Wikipedia:Categories for discussion/Log/2023 December 9#Category:AstraZeneca brands |
||
(42 intermediate revisions by 30 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Unreferenced stub|auto=yes|date=December 2009}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 447611902 |
||
| IUPAC_name = 4-chloro-''N''-(2,6-dimethyl-1-piperidyl)-3-sulfamoyl-<br>benzamide |
| IUPAC_name = 4-chloro-''N''-(2,6-dimethyl-1-piperidyl)-3-sulfamoyl-<br>benzamide |
||
| image = Clopamide.svg |
| image = Clopamide.svg |
||
| image2 = Clopamide ball-and-stick.png |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = Brinaldix |
||
| Drugs.com = {{drugs.com|international|clopamide}} |
| Drugs.com = {{drugs.com|international|clopamide}} |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
Line 16: | Line 17: | ||
| legal_US = <!-- OTC / Rx-only --> |
| legal_US = <!-- OTC / Rx-only --> |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
Line 23: | Line 24: | ||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 636-54-4 |
| CAS_number = 636-54-4 |
||
| ATC_prefix = C03 |
| ATC_prefix = C03 |
||
Line 32: | Line 34: | ||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 1361347 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 2702 |
| ChemSpiderID = 2702 |
||
| UNII_Ref = {{fdacite| |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 17S83WON0I |
| UNII = 17S83WON0I |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
Line 41: | Line 45: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=14 | H=20 | Cl=1 | N=3 | O=3 | S=1 |
| C=14 | H=20 | Cl=1 | N=3 | O=3 | S=1 |
||
| molecular_weight = 345.846 g/mol |
|||
| smiles = O=C(NN1C(CCCC1C)C)c2ccc(Cl)c(c2)S(=O)(=O)N |
| smiles = O=C(NN1C(CCCC1C)C)c2ccc(Cl)c(c2)S(=O)(=O)N |
||
| InChI = 1/C14H20ClN3O3S/c1-9-4-3-5-10(2)18(9)17-14(19)11-6-7-12(15)13(8-11)22(16,20)21/h6-10H,3-5H2,1-2H3,(H,17,19)(H2,16,20,21) |
|||
| InChIKey = LBXHRAWDUMTPSE-UHFFFAOYAR |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C14H20ClN3O3S/c1-9-4-3-5-10(2)18(9)17-14(19)11-6-7-12(15)13(8-11)22(16,20)21/h6-10H,3-5H2,1-2H3,(H,17,19)(H2,16,20,21) |
| StdInChI = 1S/C14H20ClN3O3S/c1-9-4-3-5-10(2)18(9)17-14(19)11-6-7-12(15)13(8-11)22(16,20)21/h6-10H,3-5H2,1-2H3,(H,17,19)(H2,16,20,21) |
||
Line 50: | Line 51: | ||
| StdInChIKey = LBXHRAWDUMTPSE-UHFFFAOYSA-N |
| StdInChIKey = LBXHRAWDUMTPSE-UHFFFAOYSA-N |
||
}} |
}} |
||
'''Clopamide''' is a [[piperidine]] [[diuretic]]. |
|||
'''Clopamide''' (trade name Brinaldix) is a [[piperidine]] [[diuretic]].<ref>{{cite journal | vauthors = McNeil JJ, Conway EL, Drummer OH, Howes LG, Christophidis N, Louis WJ | title = Clopamide: plasma concentrations and diuretic effect in humans | journal = Clinical Pharmacology and Therapeutics | volume = 42 | issue = 3 | pages = 299–304 | date = September 1987 | pmid = 3621784 | doi = 10.1038/clpt.1987.151 | s2cid = 20000178 }}</ref> |
|||
⚫ | |||
==Mechanism of action== |
|||
⚫ | Clopamide is categorised as a [[thiazide-like diuretic]] and works in similar way as the [[thiazide]] diuretics do. It acts in the kidneys, at the [[distal convoluted tubule]] (DCT) of the [[nephron]] where it inhibits the [[sodium-chloride symporter]]. Clopamide selectively binds at the chloride binding site of the sodium-chloride symporter in the PCT cells on the luminal (interior) side and thus interferes with the reabsorption of [[sodium chloride]], causing an equi[[osmolar]] excretion of water along with sodium chloride. |
||
== References == |
|||
<references /> |
|||
{{Diuretics}} |
{{Diuretics}} |
||
⚫ | |||
[[Category:Piperidines]] |
[[Category:Piperidines]] |
||
[[Category:Benzamides]] |
|||
[[Category:Sulfonamides]] |
[[Category:Sulfonamides]] |
||
[[Category:Organochlorides]] |
|||
[[Category:Hydrazides]] |
[[Category:Hydrazides]] |
||
[[Category:Drugs developed by Novartis]] |
|||
⚫ | |||
[[Category:Carbonic anhydrase inhibitors]] |
|||
{{cardiovascular-drug-stub}} |
|||
[[es:Clopamida]] |
|||
[[pl:Klopamid]] |