Asoprisnil: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
 {{Drugbox
+| Verifiedfields = changed
 | Watchedfields = changed
-| verifiedrevid = 444339964
+| verifiedrevid = 457821303
+| IUPAC_name = (8S,11R,13S,14S,17S)-11-[4-[(E)-hydroxyiminomethyl]phenyl]-17-methoxy-17-(methoxymethyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one
-| IUPAC_name = rel-4-[(8R,11S,13R,14R,17R)-17-Methoxy-17-
-| image = Asoprisnil.png
+| image = Asoprisnil.svg
+| width = 250
 <!--Clinical data-->
 | tradename =
 | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
 | pregnancy_US = <!-- A / B            / C / D / X -->
 | pregnancy_category =
 | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
 | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
 | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
 | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
 | legal_status =
 | routes_of_administration =
 <!--Pharmacokinetic data-->
 | bioavailability =
 | protein_bound =
 | metabolism =
 | elimination_half-life =
 | excretion =
 <!--Identifiers-->
+| CAS_number_Ref = {{cascite|changed|??}}
-| CAS_number = <!-- blanked - oldvalue: 199396-76-4 -->
+| CAS_number = 199396-76-4
-| ATC_prefix = none
-| ATC_suffix =
+| ATC_prefix = None
-| ATC_supplemental =
+| ATC_suffix =
+| ATC_supplemental =
+| ChEMBL_Ref = {{ebicite|correct|EBI}}
 | ChEMBL = 267431
 | PubChem = 9577221
+| IUPHAR_ligand = 2883
 | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
 | DrugBank =
 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 7851660
@@ Line 41: / Line 47: @@
 <!--Chemical data-->
-| chemical_formula =
 | C=28 | H=35 | N=1 | O=4
-| molecular_weight = 449.582 g/mol
 | smiles = O=C5\C=C4/C(=C3/[C@@H](c1ccc(\C=N\O)cc1)C[C@]2([C@@H](CC[C@@]2(OC)COC)[C@@H]3CC4)C)CC5
-| InChI = 1/C28H35NO4/c1-27-15-24(19-6-4-18(5-7-19)16-29-31)26-22-11-9-21(30)14-20(22)8-10-23(26)25(27)12-13-28(27,33-3)17-32-2/h4-7,14,16,23-25,31H,8-13,15,17H2,1-3H3/b29-16+/t23-,24+,25-,27-,28+/m0/s1
-| InChIKey = GJMNAFGEUJBOCE-MEQIQULJBJ
 | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChI = 1S/C28H35NO4/c1-27-15-24(19-6-4-18(5-7-19)16-29-31)26-22-11-9-21(30)14-20(22)8-10-23(26)25(27)12-13-28(27,33-3)17-32-2/h4-7,14,16,23-25,31H,8-13,15,17H2,1-3H3/b29-16+/t23-,24+,25-,27-,28+/m0/s1
@@ Line 53: / Line 55: @@
 }}
-'''Asoprisnil''' (J867) is an investigational [[selective progesterone receptor modulator]] developed by [[Schering]] and [[TAP Pharmaceutical Products]], tested for treatment of progesterone sensitive myomata.<ref>{{cite journal |author=DeManno D, Elger W, Garg R, ''et al.'' |title=Asoprisnil (J867): a selective progesterone receptor modulator for gynecological therapy |journal=Steroids |volume=68 |issue=10-13 |pages=1019–32 |year=2003 |pmid=14667995 |doi=10.1016/j.steroids.2003.09.008}}</ref>
+'''Asoprisnil''' ([[International Nonproprietary Name|INN]]; developmental code name '''J-867''') is a [[synthetic compound|synthetic]], [[steroid]]al [[selective progesterone receptor modulator]] that was under development by [[Schering AG|Schering]] and [[TAP Pharmaceutical Products]] for the treatment of [[uterine fibroids]].<ref>{{cite journal |vauthors=DeManno D, Elger W, Garg R |title=Asoprisnil (J867): a selective progesterone receptor modulator for gynecological therapy |journal=Steroids |volume=68 |issue=10–13 |pages=1019–32 |year=2003 |pmid=14667995 |doi=10.1016/j.steroids.2003.09.008|s2cid=23074350 |display-authors=etal}}</ref> In 2005, [[Phases of clinical research#Phase III|phase III]] [[clinical trial]]s were discontinued due to [[endometrium|endometrial]] changes in patients.<ref>[http://www.schering.de/html/en/50_media/download/_files/2005/fin_rep/interim/05q3_areas_en.pdf Schering Interim Report Q1-3 2005]</ref>
+==See also==
-In 2005, [[Phase III trials]] were discontinued due to endometrial changes in patients. It is uncertain whether asoprisnil will be marketed.<ref>[http://www.schering.de/html/en/50_media/download/_files/2005/fin_rep/interim/05q3_areas_en.pdf Schering Interim Report Q1-3 2005]</ref>
+* [[Asoprisnil ecamate]]
+* [[Mifepristone]]
+* [[Ulipristal acetate]]
+* [[Vilaprisan]]
-== References ==
+==References==
-{{Reflist}}
+{{reflist|30em}}
+{{Glucocorticoid receptor modulators}}
-{{Sex hormones}}
+{{Progesterone receptor modulators}}
-[[Category:Hormonal agents]]
+[[Category:Antiglucocorticoids]]
-[[Category:Oximes]]
+[[Category:Estranes]]
+[[Category:Experimental drugs]]
+[[Category:Enones]]
+[[Category:Aldoximes]]
+[[Category:Selective progesterone receptor modulators]]