Asoprisnil: Difference between revisions
Appearance
Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number'). |
Importing Wikidata short description: "Chemical compound" (Shortdesc helper) |
||
(28 intermediate revisions by 19 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 457821303 |
||
| IUPAC_name = (8S,11R,13S,14S,17S)-11-[4-[(E)-hydroxyiminomethyl]phenyl]-17-methoxy-17-(methoxymethyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|||
| IUPAC_name = rel-4-[(8R,11S,13R,14R,17R)-17-Methoxy-17- |
|||
| image = Asoprisnil. |
| image = Asoprisnil.svg |
||
| width = 250 |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
||
| pregnancy_US = <!-- A / B / C / D / X --> |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| pregnancy_category = |
| pregnancy_category = |
||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| protein_bound = |
| protein_bound = |
||
| metabolism = |
| metabolism = |
||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|changed|??}} |
|||
| CAS_number = |
| CAS_number = 199396-76-4 |
||
| ATC_prefix = none |
|||
| |
| ATC_prefix = None |
||
| |
| ATC_suffix = |
||
| ATC_supplemental = |
|||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|||
| ChEMBL = 267431 |
| ChEMBL = 267431 |
||
| PubChem = 9577221 |
| PubChem = 9577221 |
||
| IUPHAR_ligand = 2883 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 7851660 |
| ChemSpiderID = 7851660 |
||
Line 41: | Line 47: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| chemical_formula = |
|||
| C=28 | H=35 | N=1 | O=4 |
| C=28 | H=35 | N=1 | O=4 |
||
| molecular_weight = 449.582 g/mol |
|||
| smiles = O=C5\C=C4/C(=C3/[C@@H](c1ccc(\C=N\O)cc1)C[C@]2([C@@H](CC[C@@]2(OC)COC)[C@@H]3CC4)C)CC5 |
| smiles = O=C5\C=C4/C(=C3/[C@@H](c1ccc(\C=N\O)cc1)C[C@]2([C@@H](CC[C@@]2(OC)COC)[C@@H]3CC4)C)CC5 |
||
| InChI = 1/C28H35NO4/c1-27-15-24(19-6-4-18(5-7-19)16-29-31)26-22-11-9-21(30)14-20(22)8-10-23(26)25(27)12-13-28(27,33-3)17-32-2/h4-7,14,16,23-25,31H,8-13,15,17H2,1-3H3/b29-16+/t23-,24+,25-,27-,28+/m0/s1 |
|||
| InChIKey = GJMNAFGEUJBOCE-MEQIQULJBJ |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C28H35NO4/c1-27-15-24(19-6-4-18(5-7-19)16-29-31)26-22-11-9-21(30)14-20(22)8-10-23(26)25(27)12-13-28(27,33-3)17-32-2/h4-7,14,16,23-25,31H,8-13,15,17H2,1-3H3/b29-16+/t23-,24+,25-,27-,28+/m0/s1 |
| StdInChI = 1S/C28H35NO4/c1-27-15-24(19-6-4-18(5-7-19)16-29-31)26-22-11-9-21(30)14-20(22)8-10-23(26)25(27)12-13-28(27,33-3)17-32-2/h4-7,14,16,23-25,31H,8-13,15,17H2,1-3H3/b29-16+/t23-,24+,25-,27-,28+/m0/s1 |
||
Line 53: | Line 55: | ||
}} |
}} |
||
'''Asoprisnil''' ( |
'''Asoprisnil''' ([[International Nonproprietary Name|INN]]; developmental code name '''J-867''') is a [[synthetic compound|synthetic]], [[steroid]]al [[selective progesterone receptor modulator]] that was under development by [[Schering AG|Schering]] and [[TAP Pharmaceutical Products]] for the treatment of [[uterine fibroids]].<ref>{{cite journal |vauthors=DeManno D, Elger W, Garg R |title=Asoprisnil (J867): a selective progesterone receptor modulator for gynecological therapy |journal=Steroids |volume=68 |issue=10–13 |pages=1019–32 |year=2003 |pmid=14667995 |doi=10.1016/j.steroids.2003.09.008|s2cid=23074350 |display-authors=etal}}</ref> In 2005, [[Phases of clinical research#Phase III|phase III]] [[clinical trial]]s were discontinued due to [[endometrium|endometrial]] changes in patients.<ref>[http://www.schering.de/html/en/50_media/download/_files/2005/fin_rep/interim/05q3_areas_en.pdf Schering Interim Report Q1-3 2005]</ref> |
||
==See also== |
|||
In 2005, [[Phase III trials]] were discontinued due to endometrial changes in patients. It is uncertain whether asoprisnil will be marketed.<ref>[http://www.schering.de/html/en/50_media/download/_files/2005/fin_rep/interim/05q3_areas_en.pdf Schering Interim Report Q1-3 2005]</ref> |
|||
* [[Asoprisnil ecamate]] |
|||
* [[Mifepristone]] |
|||
* [[Ulipristal acetate]] |
|||
* [[Vilaprisan]] |
|||
== |
==References== |
||
{{ |
{{reflist|30em}} |
||
{{Glucocorticoid receptor modulators}} |
|||
{{Sex hormones}} |
|||
{{Progesterone receptor modulators}} |
|||
[[Category: |
[[Category:Antiglucocorticoids]] |
||
[[Category: |
[[Category:Estranes]] |
||
[[Category:Experimental drugs]] |
|||
[[Category:Enones]] |
|||
[[Category:Aldoximes]] |
|||
[[Category:Selective progesterone receptor modulators]] |
|||