5-Me-MiPT: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
-{{DISPLAYTITLE:5,''N''-Dimethyl-''N''-isopropyltryptamine}}
+{{Drugbox
-{{drugbox
-| verifiedrevid = 426279925
+| verifiedrevid = 426281436
+| IUPAC_name = Isopropyl-(2-(1''H''-indol-3-yl)-ethyl)-methylamine
-| drug_name = 5,''N''-Dimethyl-''N''-isopropyltryptamine
-| IUPAC_name = isopropyl-(2-(1''H''-indol-3-yl)-ethyl)-methylamine
 | image = 5-Me-MiPT.svg
 | width = 200px
+| drug_name = 5,''N''-Dimethyl-''N''-isopropyltryptamine
+<!--Clinical data-->
+| tradename =
+| pregnancy_AU =
+| pregnancy_US =
+| pregnancy_category =
+| legal_AU =
+| legal_CA =
+| legal_UK =
+| legal_US =
+| legal_status =
+| routes_of_administration =
+<!--Pharmacokinetic data-->
+| bioavailability =
+| protein_bound =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number_Ref = {{cascite|correct|??}}
 | CAS_number = 127506-99-4
 | ATC_prefix =
 | ATC_suffix =
 | PubChem =
+| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
-| C=15 | H=22 | N=2
-| molecular_weight = 230.36 g/mol
-| smiles = CC(C)N(C)CCc1cnc(cc2)c1cc2C
-|  ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
 | ChemSpiderID = 25991466
-|  StdInChI_Ref = {{stdinchicite|correct|chemspider}}
+<!--Chemical data-->
-| StdInChI=1S/C15H22N2/c1-11(2)17(4)8-7-13-10-16-15-6-5-12(3)9-14(13)15/h5-6,9-11,16H,7-8H2,1-4H3
+| C=15 | H=22 | N=2
+| smiles = CC(C)N(C)CCc1c[nH]c(cc2)c1cc2C
+| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
+| StdInChI = 1S/C15H22N2/c1-11(2)17(4)8-7-13-10-16-15-6-5-12(3)9-14(13)15/h5-6,9-11,16H,7-8H2,1-4H3
 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
 | StdInChIKey = SDMXVRZAGORZLX-UHFFFAOYSA-N
 | melting_point =
 | melting_high =
-| bioavailability =
-| protein_bound =
-| metabolism =
-| elimination_half-life =
-| excretion =
-| pregnancy_AU =
-| pregnancy_US =
-| pregnancy_category =
-| legal_AU =
-| legal_CA =
-| legal_UK =
-| legal_US =
-| legal_status =
-| routes_of_administration =
 }}
-'''5,''N''-dimethyl-''N''-isopropyltryptamine''' (5-Me-MIPT) is a [[tryptamine]] derivative that is thought to be a [[hallucinogenic]] drug. It was first made in 1989. ''In vitro'' binding experiments on brain homogenates showed it to have a binding affinity between that of [[N-Methyl-N-isopropyltryptamine |MIPT]] and [[5-MeO-MIPT]], <ref>{{cite journal | doi = 10.1016/0028-3908(90)90001-8 | author = McKenna DJ, Repke DB, Peroutka SJ | title = Differential interactions of indolealkylamines with 5-hydroxytryptamine receptor subtypes | journal = Neuropharmacology | volume = 29 | issue = 3 | pages = 193–198 | year = 1989 | pmid = 2139186}}</ref> both of which are known to be active hallucinogens in humans.
+'''5,''N''-Dimethyl-''N''-isopropyltryptamine''' ('''5-Me-MiPT''') is a [[tryptamine]] derivative that is thought to be a [[psychedelic drug]]. It was first made in 1989. ''In vitro'' binding experiments on brain homogenates showed it to have [[serotonin receptor]] binding affinity between that of [[N-Methyl-N-isopropyltryptamine|MiPT]] and [[5-MeO-MiPT]],<ref>{{cite journal | doi = 10.1016/0028-3908(90)90001-8 | vauthors = McKenna DJ, Repke DB, Peroutka SJ | title = Differential interactions of indolealkylamines with 5-hydroxytryptamine receptor subtypes | journal = Neuropharmacology | volume = 29 | issue = 3 | pages = 193–198 | year = 1989 | pmid = 2139186| doi-access = free }}</ref> both of which are known to be active psychedelics in humans.
 == References ==
 {{reflist}}
-{{DEFAULTSORT:Dimethyl-N-isopropyltryptamine, 5,N-}}
-{{hallucinogen-stub}}
 {{hallucinogenic tryptamines}}
+{{DEFAULTSORT:Dimethyl-N-isopropyltryptamine, 5,N-}}
 [[Category:Psychedelic tryptamines]]
+{{hallucinogen-stub}}