Jump to content

4-Methyl-α-ethyltryptamine: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
Added CSID, (std)InChI, and (std)InChIkey
 
(50 intermediate revisions by 29 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Unreliable sources|date=April 2010}}
{{Drugbox
{{Drugbox
| verifiedrevid = 424655218
| verifiedrevid = 452179546
| IUPAC_name = 1-ethyl-2-(4-methyl-1''H''-indol-3-yl)-ethylamine
| IUPAC_name = 1-(4-Methyl-1''H''-indol-3-yl)butan-2-amine
| image = 4-Methyl-AET.png
| image = 4-Methyl-AET.png
| image2 = 4-Methyl-AET 3d ballandsticks.gif


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| pregnancy_category =
| pregnancy_category =
| legal_status = Illegal in Singapore
| legal_status = Uncontrolled <small>(but may be covered under the [[Federal Analogue Act]] in the [[United States]] and under similar bills in other countries)</small>
| routes_of_administration = ?
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| CAS_number = 28289-30-7
| CAS_number = 28289-30-7
| CAS_number_Ref = {{Cascite|correct|CAS}}
| ATC_prefix = none
| ATC_prefix = none
| PubChem = ?
| PubChem = 57466062
| UNII_Ref = {{fdacite|correct|FDA}}
⚫
| ChemSpiderID = 26234938
| UNII = SBF4N6JJ4L
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫
| ChemSpiderID = 26234938
| synonyms =


<!--Chemical data-->
<!--Chemical data-->
| C=13 | H=18 | N=2
| C=13 | H=18 | N=2
⚫
| smiles = Cc2c1c(CC(N)CC)c[nH]c1ccc2
| molecular_weight = 202.30 g/mol
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
⚫
| smiles = Cc2c1c(CC(N)CC)cnc1ccc2
| InChI = 1/C13H18N2/c1-3-11(14)7-10-8-15-12-6-4-5-9(2)13(10)12/h4-6,8,11,15H,3,7,14H2,1-2H3
| StdInChI = 1S/C13H18N2/c1-3-11(14)7-10-8-15-12-6-4-5-9(2)13(10)12/h4-6,8,11,15H,3,7,14H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey = XKHCIOVNXOVPIK-UHFFFAOYAK
| StdInChIKey = XKHCIOVNXOVPIK-UHFFFAOYSA-N
| StdInChI = 1S/C13H18N2/c1-3-11(14)7-10-8-15-12-6-4-5-9(2)13(10)12/h4-6,8,11,15H,3,7,14H2,1-2H3
| StdInChIKey = XKHCIOVNXOVPIK-UHFFFAOYSA-N
}}
}}


'''4-Methyl-α-ethyltryptamine''' ('''4-Methyl-αET''') is a putative [[stimulant]], [[psychedelic drug|psychedelic]], and [[entactogen]] [[drug]] of the [[tryptamine]] class.<ref>Cerletti A, Taeschler M, Weidmann H. Pharmacologic studies on the structure-activity relationship of hydroxyindole alkylamines. ''Advances in Pharmacology (New York)'' 1968;6(Part B):233.</ref> It is a novel [[designer drug]] and has been sold online as a '[[research chemical]]' since 2010.<ref name="urlBluelight Forums - 4-Methyl-AET - New Research Chemical on the Market">{{cite web | url = http://bluelight.ru/vb/showthread.php?t=499810 | title = Bluelight Forums - 4-Methyl-AET - New Research Chemical on the Market | accessdate = April 2010 | url = http://bluelight.ru/vb/showthread.php?t=499810}}</ref>
'''4-Methyl-α-ethyltryptamine''' ('''4-Me-αET''') is a putative [[stimulant]], [[psychedelic drug|psychedelic]], and [[entactogen]] [[drug]] of the [[tryptamine]] class.<ref name="pmid5658327">{{cite book | vauthors = Cerletti A, Taeschler M, Weidmann H | title = Pharmacology, Behavior, and Clinical Aspects, Proceedings of a Symposium held at the College of Physicians and Surgeons, Columbia University, New York | chapter = Pharmacologic studies on the structure-activity relationship of hydroxyindole alkylamines | series = Advances in Pharmacology | volume = 6 | issue = Pt B | pages = 233–46 | date = 1968 | pmid = 5658327 | doi = 10.1016/s1054-3589(08)60322-1 | isbn = 978-0-12-032906-9 }}</ref> It is a [[designer drug]] and is sold online as a "[[research chemical]]".<ref>{{cite journal| vauthors = Chapman SJ |title=PeakAL: Protons I Have Known and Loved, Too — Another Fifty Shades of Grey-Market Spectra|journal=Blotter|date=1 Mar 2018|issue=5|doi=10.16889/isomerdesign-5|url=https://isomerdesign.com/doi/5/index.php|access-date=3 April 2018|doi-access=free}}</ref>

==Legality==
4-Methyl-α-ethyltryptamine is illegal in Singapore.<ref>{{cite web|title=Misuse of Drugs Act - Singapore Statutes Online|url=https://sso.agc.gov.sg/Act/MDA1973|website=sso.agc.gov.sg}}</ref>


== See also ==
== See also ==
* [[4-Methyl-αMT]]
* [[4-Methyl-αMT]]
* [[5-Fluoro-αET]]
* [[7-Chloro-αMT]]
* [[7-Methyl-αET]]
* [[7-Methyl-αET]]
* [[RS134-49]]
* [[alpha-Ethyltryptamine|α-Ethyltryptamine]] (αET)
* [[alpha-Methyltryptamine|α-Methyltryptamine]] (αMT)


== References ==
== References ==
{{Reflist}}
{{Reflist}}


{{Entactogens}}
{{Entactogens|state=expanded}}
{{Stimulants}}
{{Stimulants}}
{{Hallucinogens}}
{{Hallucinogens}}
{{Serotonin receptor modulators}}
{{Adrenergics}}
{{Monoamine releasing agents}}
{{Dopaminergics}}
{{Serotonergics}}
{{Tryptamines}}
{{Tryptamines}}

{{DEFAULTSORT:Methyl-alpha-ethyltryptamine, 4-}}


[[Category:Psychedelic tryptamines]]
[[Category:Psychedelic tryptamines]]
[[Category:Serotonin receptor agonists]]
[[Category:Serotonin-norepinephrine-dopamine releasing agents]]
[[Category:Entactogens and empathogens]]


{{nervous-system-drug-stub}}
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"