Jump to content

2,α-Dimethyltryptamine: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Wikipedia:WikiProject Chemicals/Chembox validation|Chem/
 
(15 intermediate revisions by 9 users not shown)
Line 1: Line 1:
{{short description|Chemical compound}}
{{Drugbox
{{Infobox drug
| verifiedrevid = 443313080
| Watchedfields = changed
| IUPAC_name = 1-(2-methyl-1H-indol-3-yl)propan-2-amine
| verifiedrevid = 443314047
| IUPAC_name = 1-(2-methyl-1''H''-indol-3-yl)propan-2-amine
| image = 2,a-DMT.svg
| image = 2,a-DMT.svg
| width = 200
| width = 200
| image2 = 2,alpha-DMT_3d_structure.png
| image2 = 2,alpha-DMT_3d_structure.png
<!--Clinical data-->
| width = 200
| tradename =
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number = 4966-28-3
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| ATC_prefix =
| pregnancy_category =
| ATC_suffix =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number = 4966-28-3
| ATC_prefix =
| ATC_suffix =
| PubChem =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 23511903
<!--Chemical data-->
| chemical_formula =
| C=12 | H=16 | N=2
| molecular_weight =
| smiles = Cc1c(c2ccccc2[nH]1)CC(C)N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H16N2/c1-8(13)7-11-9(2)14-12-6-4-3-5-10(11)12/h3-6,8,14H,7,13H2,1-2H3
| StdInChI = 1S/C12H16N2/c1-8(13)7-11-9(2)14-12-6-4-3-5-10(11)12/h3-6,8,14H,7,13H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = AXZQFXRPULJFQK-UHFFFAOYSA-N
| StdInChIKey = AXZQFXRPULJFQK-UHFFFAOYSA-N
| PubChem =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 23511903
| smiles = Cc1c(c2ccccc2[nH]1)CC(C)N
| InChI = 1S/C12H16N2/c1-8(13)7-11-9(2)14-12-6-4-3-5-10(11)12/h3-6,8,14H,7,13H2,1-2H3
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| chemical_formula =|C=12|H=16|N=2
| molecular_weight =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}
}}


'''2,alpha-DMT''', or '''2,α-dimethyltryptamine''', is a [[tryptamine]] and a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]]. It is the 2,a-di[[methyl]] [[analog (chemistry)| analog]] of [[dimethyltryptamine|DMT]]. 2,α-DMT was first synthesized by [[Alexander Shulgin]]. In his book ''[[TiHKAL]]'' (''Tryptamines I Have Known and Loved''), Shulgin lists the dosage as 300-500 [[milligram|mg]], and the duration as 7-10 hours.<ref>{{CiteTiHKAL|pages=422}}</ref> 2,α-DMT causes [[mydriasis]] and [[paresthesia]]. It also produces a calm, [[drunk]]-like feeling. Very little data exists about the pharmacological properties, metabolism, and toxicity of 2,α-DMT.
'''2,α-Dimethyltryptamine''' ('''2,α-DMT''') is a [[tryptamine]] and a lesser-known [[Psychedelics, dissociatives and deliriants|psychedelic drug]]. It is the 2,α-di[[methyl]] [[analog (chemistry)|analog]] of [[dimethyltryptamine|DMT]]. Its synthesis was first reported in 1965.<ref>{{cite journal | vauthors = Heath-Brown B, Philpott PG |title=Studies in the Indole Series. Part I. Indolylalkylamines |journal=Journal of the Chemical Society |date=1965 |issue=Dec |pages=7165–7178|doi=10.1039/jr9650007165 }}</ref> [[Alexander Shulgin]] lists the dosage as 300-500 [[milligram|mg]], and the duration as 7–10 hours in his book ''[[TiHKAL]]'' (''Tryptamines I Have Known and Loved'').<ref>{{CiteTiHKAL|pages=422|name-list-style = vanc }}</ref> 2,α-DMT causes [[mydriasis]] and [[paresthesia]]. It also produces a calm, [[drunk]]-like feeling. Very little data exists about the pharmacological properties, metabolism, and toxicity of 2,α-DMT.


==References==
==References==
Line 45: Line 50:


==External links==
==External links==

* [http://www.erowid.org/library/books_online/tihkal/tihkal07.shtml 2,a-DMT Entry in ''TIHKAL'']
* [http://www.erowid.org/library/books_online/tihkal/tihkal07.shtml 2,a-DMT Entry in ''TIHKAL'']
* [http://tihkal.info/read.php?domain=tk&id=7 2,α-DMT Entry in TiHKAL • info]
* [http://tihkal.info/read.php?domain=tk&id=7 2,α-DMT Entry in TiHKAL • info]


{{TiHKAL}}
{{Tryptamines}}


{{DEFAULTSORT:DMT, 2,alpha-}}
{{DEFAULTSORT:DMT, 2, alpha-}}
[[Category:Psychedelic tryptamines]]
[[Category:Psychedelic tryptamines]]



{{Psychoactive-stub}}
{{Psychoactive-stub}}