Jump to content

Aceprometazine: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
BogBot (talk | contribs)
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot
CheMoBot (talk | contribs)
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or bugs)
Line 1: Line 1:
{{Unreferenced|date=December 2010}}
{{Unreferenced|date=December 2010}}
{{Drugbox
{{Drugbox
| verifiedrevid = 443363417
| verifiedrevid = 443364752
| IUPAC_name = 1-{10-[2-(dimethylamino)propyl]-10''H''-phenothiazin-2-yl}ethanone
| IUPAC_name = 1-{10-[2-(dimethylamino)propyl]-10''H''-phenothiazin-2-yl}ethanone
| image = Aceprometazine.svg
| image = Aceprometazine.svg

Revision as of 00:23, 31 August 2011

{{Drugbox | verifiedrevid = 443364752 | IUPAC_name = 1-{10-[2-(dimethylamino)propyl]-10H-phenothiazin-2-yl}ethanone | image = Aceprometazine.svg

| tradename = | pregnancy_category = Contraindicated
Passes into breast milk | legal_status = Rx-only | routes_of_administration = Oral

| bioavailability = | protein_bound = | metabolism = Hepatic | elimination_half-life = | excretion = Renal and fecal

| CASNo_Ref =  checkY | CAS_number = 13461-01-3 | ATC_prefix = none | ATC_suffix = | PubChem = 26035 | DrugBank_Ref =  checkY | DrugBank = DB01615 | ChemSpiderID_Ref =  checkY | ChemSpiderID = 24249 | UNII_Ref =  checkY | UNII = 984N9YTM4Y | ChEBI_Ref =  checkY | ChEBI = 53770

| C=19 | H=22 | N=2 | O=1 | S=1 | molecular_weight = 326.456 g/mol | smiles = O=C(c2cc1N(c3c(Sc1cc2)cccc3)CC(N(C)C)C)C | InChI = 1/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 | InChIKey = XLOQNFNTQIRSOX-UHFFFAOYAZ | StdInChI_Ref =  checkY | StdInChI = 1S/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 | StdInChIKey_Ref =  checkY | StdInChIKey = XLOQNFNTQIRSOX-UHFFFAOYSA-N }} Aceprometazine (INN) is a phenothiazine derivative prescription drug with neuroleptic and anti-histamine properties. It is not widely prescribed. It may be used in combination with meprobamate for the treatment of sleep disorders. This combination is available in France under the trade name Mepronizine.