Sodyum florosilikat sayfasının kaynağını görüntüle

{{Chembox
| PIN = 
| SystematicName = Sodyum hekzaflorosilikat(2–)
<ref>Parent Hydride Names and Substitutive Nomenclature [http://old.iupac.org/publications/books/rbook/Red_Book_2005.pdf], title = Nomenclature of Inorganic Chemistry, IUPAC Recommendations 2005. s. 114–135</ref>
| OtherNames = 
| ImageFile = Natriumhexafluorosilicat.png
| ImageSize = 250px
| ImageAlt = Unit cell of the compound
| ImageCaption = Unit cell of sodium hexafluoridosilicate
|Section1={{Chembox Identifiers
| CASNo = 16893-85-9
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 806AV2E065
| PubChem = 28127
| ChemSpiderID = 26165
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| EINECS = 240-934-8
| UNNumber = 2674
| RTECS = VV8410000
| SMILES = [Na+].[Na+].F[Si--](F)(F)(F)(F)F
| StdInChI = 1S/F6Si.2Na/c1-7(2,3,4,5)6;;/q-2;2*+1
| StdInChIKey = TWGUZEUZLCYTCG-UHFFFAOYSA-N}}
|Section2={{Chembox Properties
| Formula= Na<sub>2</sub>[SiF<sub>6</sub>] 
| MolarMass = 188 g/mol
| Appearance = beyaz granüllü katı
| Odor = kokusuz
| Density = 2.7 g/cm<sup>3</sup>
| Solubility = 0.64 g/100 mL (20 °C) <br> 1.27 g/100 mL (50 °C) <br> 2.45 g/100 mL (100 °C)
| SolubleOther = ialkolde çözünmez
| RefractIndex = 1.312
}}
| Section3 = {{Chembox Structure
| Structure_ref = <ref>{{dergi kaynağı|author=Allan Zalkin, J. D. Forrester, David H. Templeton|yıl=1964|cilt=17|sayfalar=1408-1412|doi=10.1107/S0365110X64003516|doi-access=free|dergi=Acta Crystallographica|başlık=The Crystal Structure of Sodium Fluorosilicate|sayı=11|bibcode=1964AcCry..17.1408Z }}</ref>
| CrystalStruct = trigonal
| SpaceGroup = P321 
| LattConst_a = 8.859
| LattConst_c = 5.038
| UnitCellFormulas = 4
  }}
|Section4={{Chembox Hazards
| NFPA-H = 2
| NFPA-F = 0
| NFPA-R = 0
| LDLo = 70 mg/kg (mouse, oral)<br/>125 mg/kg (rabbit, oral)<ref>{{IDLH|fluoride|Fluorides (as F)}}</ref>
}}
}}
'''Sodyum florosilikat''', Na<sub>2</sub>[SiF<sub>6</sub>] kimyasal formülüne sahip bir bileşiktir. Diğer sodyum tuzlarının aksine, suda düşük çözünürlüğe sahiptir.

==Kaynakça==