See soorce fer Nitroglycerin

{{fixscots|date=December 2020}}

{{Chembox
| Watchedfields = chynged
| verifiedrevid = 408765228
| ImageFile1 = Nitroglycerin.svg
|  ImageFile1_Ref = {{Chemboximage|correct|??}}
|  ImageSize1 = 200
|  ImageName1 = Skeletal formula o zwitterionic nitroglycerin
| ImageFile2 = Nitroglycerin-3D-vdW.png
|  ImageFile2_Ref = {{Chemboximage|correct|??}}
|  ImageSize2 = 150
|  ImageName2 = Spacefill model o nitroglycerin
| ImageFile3 = Nirtoglycerin_3D_BallStick.png
|  ImageFile3_Ref = {{Chemboximage|correct|??}}
|  ImageSize3 = 150
|  ImageName3 = Baw an stick model o nitroglycerin
| IUPACName  = 1,2,3-Trinitroxypropane
| SystematicName = 2,3-Bis(nitrooxy)propyl nitrate
| OtherNames = 1,3-Dinitrooxypropan-2-yl nitrate<br />
Propane-1,2,3-triyl trinitrate
| Section1 = {{Chembox Identifiers
|  CASNo = 55-63-0
|   CASNo_Ref = {{cascite|correct|CAS}}
|  PubChem = 4510
|   PubChem_Ref = {{Pubchemcite|correct|pubchem}}
|  ChemSpiderID = 4354
|   ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
|  UNII = G59M7S0WS3
|   UNII_Ref = {{fdacite|correct|FDA}}
|  EINECS = 200-240-8
|  UNNumber = 0143, 0144, 1204, 3064, 3319
|  DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00727
|  KEGG = D00515
|   KEGG_Ref = {{keggcite|correct|kegg}}
|  MeSHName = Nitroglycerin
|  ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 28787
|  ChEMBL = 730
|   ChEMBL_Ref = {{ebicite|correct|EBI}}
|  ATCCode_prefix = C01
|  ATCCode_suffix = DA02
|   ATC_Supplemental = {{ATC|C05|AE01}}
|  Beilstein = 1802063
|  Gmelin = 165859
|  SMILES = o:n(:o)OCC(COn(:o):o)On(:o):o
|  SMILES1 = C(C(CO[N+](=O)[O-])O[N+](=O)[O-])O[N+](=O)[O-]
|  StdInChI = 1S/C3H5N3O9/c7-4(8)13-1-3(15-6(11)12)2-14-5(9)10/h3H,1-2H2
|   StdInChI_Ref = {{stdinchicite|correct|chemspider}}
|  InChI = 1/C3H5N3O9/c7-4(8)13-1-3(15-6(11)12)2-14-5(9)10/h3H,1-2H2
|  StdInChIKey = SNIOPGDIGTZGOP-UHFFFAOYSA-N
|   StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
|  InChIKey = SNIOPGDIGTZGOP-UHFFFAOYAR
}}
| Section2 = {{Chembox Properties
|  C=3|H=5|N=3|O=9
|  ExactMass = 227.002578773 g mol<sup>−1</sup>
|  Appearance = Colourless liquid
|  Density = 1.6 g cm<sup>−3</sup> (at 15 °C)
|  MeltingPtC = 14
|  BoilingPtC = 50
|  Boiling_notes = explodes
|  LogP = 2.154
|  Solubility = slichtly<ref name="osha.gov">http://www.osha.gov/SLTC/healthguidelines/nitroglycerin/recognition.html</ref>
|  Solvent =
|  SolubleOther = acetone, ether, benzene, alcohol<ref name="osha.gov"/>
}}
| Section3 = {{Chembox Structure
|  Coordination = Tetragonal at C1, C2, an C3<br />
Trigonal planar at N7, N8, an N9
|  MolShape = Tetrahedral at C1, C2, an C3<br />
Dihedral at N7, N8, and N9
}}
| Section4 = {{Chembox Thermochemistry
|  DeltaHf = −370 kJ mol<sup>−1</sup>
|  DeltaHc = −1.529 MJ mol<sup>−1</sup>
}}
| Section5 = {{Chembox Pharmacology
|  Bioavail = <1%
|  AdminRoutes = Intravenous, Oral, Sublingual, Topical, Transdermal
|  Metabolism = Hepatic
|  HalfLife = 3 min
|  Legal_AU = S3
|  PregCat_US = C
}}
| Section6 = {{Chembox Explosive
|  ShockSens = Heich
|  FrictionSens = Heich
|  ExplosiveV = 7700 m s<sup>−1</sup>
|  REFactor = 1.50
}}
| Section7   = {{Chembox Hazards
|  EUIndex = 603-034-00-X
|  EUClass = {{Hazchem E}} {{Hazchem T+}} {{Hazchem N}}
|  RPhrases = {{R3}}, {{R12}}, {{R26/27/28}}, {{R33}}, {{R51/53}}
|  SPhrases = {{S1/2}}, {{S33}}, {{S35}}, {{S36/37}}, {{S45}}, {{S53}}, {{S61}}
|  NFPA-H = 2
|  NFPA-F = 3
|  NFPA-R = 4
}}
}}
'''Nitroglycerin''' ('''NG'''), forby kent as '''nitroglycerine''', '''trinitroglycerin''', '''trinitroglycerine''', or '''nitro''', or mair correctly as '''glyceryl trinitrate''', or mair formally as '''1,2,3-trinitroxypropane''', is a hivy, colourless, ily, [[explosive]] liquid maist commonly produced bi [[Nitration|treatin]] [[glycerol]] wi [[white fumin nitric acid]] unner condeetions appropriate tae the formation o the nitric acid ester.

==References==
{{reflist}}
{{authority control}}
[[Category:Alkyl nitrates]]
[[Category:Explosive chemicals]]
[[Category:Liquid explosives]]
[[Category:Succar alcohol explosives]]
{{stub}}