Astragalin: Difference between revisions

Astragalin
Names
	IUPAC name 3-(β-D-Glucopyranosyloxy)-4′,5,7-trihydroxyflavone
	Systematic IUPAC name 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4H-1-benzopyran-4-one
	Other names Astragaline; asragalin; kaempferol-3-glucoside; Kaempferol 3-glucoside; Kaempferol 3-O-glucoside; Kaempferol-3-O-glucoside; Kaempferol-3-D-glucoside; Kaempferol-3-beta-monoglucoside; Kaempferol 3-O-β-D-glucopyranoside
Identifiers
CAS Number	480-10-4 ;
3D model (JSmol)	Interactive image;
Beilstein Reference	100568
ChEBI	CHEBI:30200 ;
ChEMBL	ChEMBL453290 ;
ChemSpider	4445311 ;
ECHA InfoCard	100.128.596
KEGG	C12249 ;
PubChem CID	5282102;
UNII	APM8UQ3Z9O ;
CompTox Dashboard (EPA)	DTXSID801017739 ;
	InChI InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 Key: JPUKWEQWGBDDQB-QSOFNFLRSA-N ; InChI=1/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 Key: JPUKWEQWGBDDQB-QSOFNFLRBV;
	SMILES O=C2C(\O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)=C(/Oc3cc(O)cc(O)c23)c4ccc(O)cc4;
Properties
Chemical formula	C21H20O11
Molar mass	448.380 g·mol−1
Density	1.791 g/mL
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). verify (what is ?) Infobox references

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

Inline

Latest revision as of 17:32, 11 March 2024

Astragalin is a chemical compound. It can be isolated from Phytolacca americana (the American pokeweed) or in the methanolic extract of fronds of the fern Phegopteris connectilis.^[1] It is also found in wine.

Astragalin is a 3-O-glucoside of kaempferol.

References

^ Adam, Klaus-Peter (1999). "Phenolic constituents of the fern Phegopteris connectilis". Phytochemistry. 52 (5): 929–934. Bibcode:1999PChem..52..929A. doi:10.1016/S0031-9422(99)00326-X.

This article about an aromatic compound is a stub. You can help Wikipedia by expanding it.

[1] Adam, Klaus-Peter (1999). "Phenolic constituents of the fern Phegopteris connectilis". Phytochemistry. 52 (5): 929–934. Bibcode:1999PChem..52..929A. doi:10.1016/S0031-9422(99)00326-X.

[1]

@@ Line 1: / Line 1: @@
 {{chembox
+| Verifiedfields = changed
-|   Name = Astragalin
+| Watchedfields = changed
-|   ImageFile = Astragalin.svg
+| verifiedrevid = 477368973
-|   ImageSize = 250px
-|   ImageName = Astragalin structure
+| Name = Astragalin
+| ImageFile = Astragalin.svg
-|   IUPACName = 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,
+| ImageSize = 300px
--trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
+| ImageName = Astragalin structure
-|   OtherNames= Astragaline<br>asragalin<br>Trifolin<br>kaempferol-3-glucoside<br>Kaempferol 3-glucoside<br>Kaempferol 3-O-glucoside<br>Kaempferol-3-O-glucoside<br>Kaempferol-3-D-glucoside<br>Kaempferol-3-beta-monoglucoside
+| IUPACName = 3-(β-<small>D</small>-Glucopyranosyloxy)-4′,5,7-trihydroxyflavone
-| Section1 = {{Chembox Identifiers
+| SystematicName = 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-{[(2''S'',3''R'',4''S'',5''S'',6''R'')-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4''H''-1-benzopyran-4-one
-|   CASNo = 480-10-4
+| OtherNames= Astragaline<br>asragalin<br>kaempferol-3-glucoside<br>Kaempferol 3-glucoside<br>Kaempferol 3-O-glucoside<br>Kaempferol-3-O-glucoside<br>Kaempferol-3-D-glucoside<br>Kaempferol-3-beta-monoglucoside<br>Kaempferol 3-O-β-D-glucopyranoside
-|   PubChem = 5282102
+|Section1={{Chembox Identifiers
-|   Beilstein=100568
+| CASNo_Ref = {{cascite|changed|??}}
-|   SMILES = C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O)O
+| CASNo = 480-10-4
+| UNII_Ref = {{fdacite|correct|FDA}}
+| UNII = APM8UQ3Z9O
+| ChEBI_Ref = {{ebicite|correct|EBI}}
+| ChEBI = 30200
+| PubChem = 5282102
+| Beilstein=100568
+| ChEMBL_Ref = {{ebicite|changed|EBI}}
+| ChEMBL = 453290
+| KEGG_Ref = {{keggcite|correct|kegg}}
+| KEGG = C12249
+| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
+| ChemSpiderID = 4445311
+| SMILES = O=C2C(\O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)=C(/Oc3cc(O)cc(O)c23)c4ccc(O)cc4
+| InChI = 1/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1
+| InChIKey = JPUKWEQWGBDDQB-QSOFNFLRBV
+| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
+| StdInChI = 1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1
+| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
+| StdInChIKey = JPUKWEQWGBDDQB-QSOFNFLRSA-N
   }}
-| Section2 = {{Chembox Properties
+|Section2={{Chembox Properties
+| C=21 | H=20 | O=11
-|   Formula   = C<sub>21</sub>H<sub>20</sub>O<sub>11</sub>
-|   MolarMass = 448.37 g/mol
+| Density   = 1.791 g/mL
+| MeltingPt =
-|   ExactMass = 448.100561
-|   Density   =
+| BoilingPt =
-|   MeltingPt =  <!-- °C -->
-|   BoilingPt =
   }}
 }}
-'''Astragalin''' is a chemical compound. It can be isolated from ''[[Phytolacca americana]]'' (the American pokeweed).
+'''Astragalin''' is a chemical compound. It can be isolated from ''[[Phytolacca americana]]'' (the American pokeweed) or in the [[methanol]]ic extract of fronds of the fern ''[[Phegopteris connectilis]]''.<ref>{{cite journal | doi = 10.1016/S0031-9422(99)00326-X| title = Phenolic constituents of the fern Phegopteris connectilis| date = 1999| last1 = Adam| first1 = Klaus-Peter| journal = Phytochemistry| volume = 52| issue = 5| pages = 929–934| bibcode = 1999PChem..52..929A}}</ref>  It is also [[Phenolic content in wine|found in wine]].
-Astragalin is a 3-O-[[glucoside]] of [[kaempferol]].
+Astragalin is a 3-''O''-[[glucoside]] of [[kaempferol]].
+== References ==
+{{Reflist}}
+{{Flavonol}}
-<!-- ==References==
-{{Reflist}} -->
+[[Category:Kaempferol glycosides]]
-{{flavonol}}
+[[Category:Flavonol glucosides]]
+{{Aromatic-stub}}
-[[category:flavonols]]
-{{aromatic-stub}}