Jump to content

LY-215,840: Difference between revisions

From Wikipedia, the free encyclopedia
Browse history interactively
← Previous edit
Content deleted Content added
VisualWikitext
m Journal cites: format journal names, using AWB (11852)
 
(13 intermediate revisions by 11 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| IUPAC_name = (6aR,9R,10aR)-N-((1S,2R)-2-hydroxycyclopentyl)-4-isopropyl-7-methyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxamide
| IUPAC_name = (6aR,9R,10aR)-N-((1S,2R)-2-hydroxycyclopentyl)-4-isopropyl-7-methyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxamide
| image = LY-215840_structure.png
| image = LY-215840_structure.png
| width = 220
| width = 220px


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA =
| legal_CA =
| legal_UK =
| legal_UK =
| legal_US =
| legal_US =
| legal_status =
| legal_status =
| routes_of_administration =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| protein_bound =
| protein_bound =
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| IUPHAR_ligand = 180
| IUPHAR_ligand = 180
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 137328-52-0
| CAS_number = 137328-52-0
| UNII_Ref = {{fdacite|correct|FDA}}
| ATC_prefix =
| UNII = D2G5U4P5B3
| ATC_suffix =
| PubChem = 132049
| ATC_prefix =
| ATC_suffix =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| PubChem = 9822062
| DrugBank =
| DrugBank =
| ChemSpiderID = 7997811


<!--Chemical data-->
<!--Chemical data-->
| C=24 | H=33 | N=3 | O=2
| C=24 | H=33 | N=3 | O=2
| SMILES = CN1[C@]([C@]2([H])C[C@@H](C(N[C@@H]3[C@H](O)CCC3)=O)C1)([H])CC4=CN(C(C)C)C5=CC=CC2=C54
| molecular_weight = 395.54 g/mol
| StdInChI = 1S/C24H33N3O2/c1-14(2)27-13-15-11-21-18(17-6-4-8-20(27)23(15)17)10-16(12-26(21)3)24(29)25-19-7-5-9-22(19)28/h4,6,8,13-14,16,18-19,21-22,28H,5,7,9-12H2,1-3H3,(H,25,29)/t16-,18-,19+,21-,22-/m1/s1
| smiles = CN1[C@]([C@]2([H])C[C@@H](C(N[C@@H]3[C@H](O)CCC3)=O)C1)([H])CC4=CN(C(C)C)C5=CC=CC2=C54
| StdInChIKey = IMSDOBUYDTVEHN-ILMFXRJHSA-N
}}
}}


'''LY-215,840''' is an [[ergoline]] derivative drug developed by [[Eli Lilly and Company|Eli Lilly]], which acts as a potent and selective [[Antagonist (pharmacology)|antagonist]] at the [[serotonin]] [[5-HT2 receptor|5-HT<sub>2</sub>]] and [[5-HT7 receptor|5-HT<sub>7</sub>]] [[Receptor (biochemistry)|receptor]]s. It has anti-[[hypertension|hypertensive]] and [[muscle relaxant]] effects in animal studies.<ref>{{cite journal | vauthors = Cohen ML, Robertson DW, Bloomquist WE, Wilson HC | title = LY215840, a potent 5-hydroxytryptamine (5-HT)2 receptor antagonist, blocks vascular and platelet 5-HT2 receptors and delays occlusion in a rabbit model of thrombosis | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 261 | issue = 1 | pages = 202–8 | date = April 1992 | pmid = 1560366 }}</ref><ref>{{cite journal | vauthors = Cushing DJ, Zgombick JM, Nelson DL, Cohen ML | title = LY215840, a high-affinity 5-HT7 receptor ligand, blocks serotonin-induced relaxation in canine coronary artery | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 277 | issue = 3 | pages = 1560–6 | date = June 1996 | pmid = 8667223 }}</ref><ref>{{cite journal | vauthors = Terrón JA, Falcón-Neri A | title = Pharmacological evidence for the 5-HT7 receptor mediating smooth muscle relaxation in canine cerebral arteries | journal = British Journal of Pharmacology | volume = 127 | issue = 3 | pages = 609–16 | date = June 1999 | pmid = 10401550 | pmc = 1566051 | doi = 10.1038/sj.bjp.0702580 }}</ref><ref>{{cite journal | vauthors = Meneses A, Terrón JA | title = Role of 5-HT(1A) and 5-HT(7) receptors in the facilitatory response induced by 8-OH-DPAT on learning consolidation | journal = Behavioural Brain Research | volume = 121 | issue = 1–2 | pages = 21–8 | date = June 2001 | pmid = 11275281 | doi = 10.1016/S0166-4328(00)00378-8 | s2cid = 26090343 }}</ref><ref>{{cite journal | vauthors = Watts SW, Yang P, Banes AK, Baez M | title = Activation of Erk mitogen-activated protein kinase proteins by vascular serotonin receptors | journal = Journal of Cardiovascular Pharmacology | volume = 38 | issue = 4 | pages = 539–51 | date = October 2001 | pmid = 11588524 | doi = 10.1097/00005344-200110000-00006 | s2cid = 43167169 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Lenglet S, Louiset E, Delarue C, Vaudry H, Contesse V | title = Activation of 5-HT(7) receptor in rat glomerulosa cells is associated with an increase in adenylyl cyclase activity and calcium influx through T-type calcium channels | journal = Endocrinology | volume = 143 | issue = 5 | pages = 1748–60 | date = May 2002 | pmid = 11956157 | doi = 10.1210/endo.143.5.8817 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Meneses A | title = Involvement of 5-HT(2A/2B/2C) receptors on memory formation: simple agonism, antagonism, or inverse agonism? | journal = Cellular and Molecular Neurobiology | volume = 22 | issue = 5–6 | pages = 675–88 | date = December 2002 | pmid = 12585687 | doi = 10.1023/A:1021800822997 | s2cid = 25703079 }}</ref><ref>{{cite journal | vauthors = Sánchez-Lopez A, Centurión D, Vázquez E, Arulmani U, Saxena PR, Villalón CM | title = Pharmacological profile of the 5-HT-induced inhibition of cardioaccelerator sympathetic outflow in pithed rats: correlation with 5-HT1 and putative 5-ht5A/5B receptors | journal = British Journal of Pharmacology | volume = 140 | issue = 4 | pages = 725–35 | date = October 2003 | pmid = 14504136 | pmc = 1574076 | doi = 10.1038/sj.bjp.0705489 }}</ref>
'''LY-215,840''' is an [[ergoline]] derivative drug developed by [[Eli Lilly and Company|Eli Lilly]], which acts as a potent and selective [[Antagonist (pharmacology)|antagonist]] at the [[serotonin]] [[5-HT2 receptor|5-HT<sub>2</sub>]] and [[5-HT7 receptor|5-HT<sub>7</sub>]] [[Receptor (biochemistry)|receptor]]s. It has anti-[[hypertension|hypertensive]] and [[muscle relaxant]] effects in animal studies.<ref>{{Cite journal
| last1 = Cohen | first1 = M. L.
| last2 = Robertson | first2 = D. W.
| last3 = Bloomquist | first3 = W. E.
| last4 = Wilson | first4 = H. C.
| title = LY215840, a potent 5-hydroxytryptamine (5-HT)2 receptor antagonist, blocks vascular and platelet 5-HT2 receptors and delays occlusion in a rabbit model of thrombosis
| journal = The Journal of Pharmacology and Experimental Therapeutics
| volume = 261
| issue = 1
| pages = 202–208
| year = 1992
| pmid = 1560366
}}</ref><ref>{{Cite journal
| last1 = Cushing | first1 = D. J.
| last2 = Zgombick | first2 = J. M.
| last3 = Nelson | first3 = D. L.
| last4 = Cohen | first4 = M. L.
| title = LY215840, a high-affinity 5-HT7 receptor ligand, blocks serotonin-induced relaxation in canine coronary artery
| journal = The Journal of Pharmacology and Experimental Therapeutics
| volume = 277
| issue = 3
| pages = 1560–1566
| year = 1996
| pmid = 8667223
}}</ref><ref>{{Cite journal
| last1 = Terrón | first1 = J. A.
| last2 = Falcón-Neri | first2 = A.
| doi = 10.1038/sj.bjp.0702580
| title = Pharmacological evidence for the 5-HT7receptor mediating smooth muscle relaxation in canine cerebral arteries
| journal = British Journal of Pharmacology
| volume = 127
| issue = 3
| pages = 609–616
| year = 1999
| pmid = 10401550
| pmc =1566051
}}</ref><ref>{{Cite journal
| doi = 10.1016/S0166-4328(00)00378-8
| last1 = Meneses | first1 = A.
| last2 = Terrón | first2 = J. A.
| title = Role of 5-HT(1A) and 5-HT(7) receptors in the facilitatory response induced by 8-OH-DPAT on learning consolidation
| journal = Behavioural Brain Research
| volume = 121
| issue = 1–2
| pages = 21–28
| year = 2001
| pmid = 11275281
}}</ref><ref>{{Cite journal
| doi = 10.1097/00005344-200110000-00006
| last1 = Watts | first1 = S. W.
| last2 = Yang | first2 = P.
| last3 = Banes | first3 = A. K.
| last4 = Baez | first4 = M.
| title = Activation of Erk mitogen-activated protein kinase proteins by vascular serotonin receptors
| journal = Journal of cardiovascular pharmacology
| volume = 38
| issue = 4
| pages = 539–551
| year = 2001
| pmid = 11588524
}}</ref><ref>{{Cite journal
| doi = 10.1210/en.143.5.1748
| last1 = Lenglet | first1 = S.
| last2 = Louiset | first2 = E.
| last3 = Delarue | first3 = C.
| last4 = Vaudry | first4 = H.
| last5 = Contesse | first5 = V.
| title = Activation of 5-HT(7) receptor in rat glomerulosa cells is associated with an increase in adenylyl cyclase activity and calcium influx through T-type calcium channels
| journal = Endocrinology
| volume = 143
| issue = 5
| pages = 1748–1760
| year = 2002
| pmid = 11956157
}}</ref><ref>{{Cite journal
| doi = 10.1023/A:1021800822997
| last1 = Meneses | first1 = A.
| title = Involvement of 5-HT(2A/2B/2C) receptors on memory formation: Simple agonism, antagonism, or inverse agonism?
| journal = Cellular and molecular neurobiology
| volume = 22
| issue = 5–6
| pages = 675–688
| year = 2002
| pmid = 12585687
}}</ref><ref>{{Cite journal
| last1 = Sánchez-López | first1 = A.
| last2 = Centurión | first2 = D.
| last3 = Vázquez | first3 = E.
| last4 = Arulmani | first4 = U.
| last5 = Saxena | first5 = P. R.
| last6 = Villalón | first6 = C. M.
| doi = 10.1038/sj.bjp.0705489
| title = Pharmacological profile of the 5-HT-induced inhibition of cardioaccelerator sympathetic outflow in pithed rats: Correlation with 5-HT1and putative 5-ht5A/5Breceptors
| journal = British Journal of Pharmacology
| volume = 140
| issue = 4
| pages = 725–735
| year = 2003
| pmid = 14504136
| pmc =1574076
}}</ref>


== References ==
==References==
{{reflist}}
{{Reflist}}



{{Serotonergics}}
{{Serotonin receptor modulators}}
{{Ergolines}}


[[Category:5-HT2 antagonists]]
[[Category:5-HT2 antagonists]]
[[Category:Cyclopentanes]]
[[Category:Ergolines]]
[[Category:Ergolines]]
[[Category:Eli Lilly and Company]]
[[Category:Drugs developed by Eli Lilly and Company]]




{{nervous-system-drug-stub}}
{{Nervous-system-drug-stub}}

Latest revision as of 19:32, 20 December 2023

LY-215,840
Identifiers
  • (6aR,9R,10aR)-N-((1S,2R)-2-hydroxycyclopentyl)-4-isopropyl-7-methyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxamide
CAS Number
PubChem CID
IUPHAR/BPS
ChemSpider
UNII
CompTox Dashboard (EPA)
Chemical and physical data
FormulaC24H33N3O2
Molar mass395.547 g·mol−1
3D model (JSmol)
  • CN1[C@]([C@]2([H])C[C@@H](C(N[C@@H]3[C@H](O)CCC3)=O)C1)([H])CC4=CN(C(C)C)C5=CC=CC2=C54
  • InChI=1S/C24H33N3O2/c1-14(2)27-13-15-11-21-18(17-6-4-8-20(27)23(15)17)10-16(12-26(21)3)24(29)25-19-7-5-9-22(19)28/h4,6,8,13-14,16,18-19,21-22,28H,5,7,9-12H2,1-3H3,(H,25,29)/t16-,18-,19+,21-,22-/m1/s1
  • Key:IMSDOBUYDTVEHN-ILMFXRJHSA-N

LY-215,840 is an ergoline derivative drug developed by Eli Lilly, which acts as a potent and selective antagonist at the serotonin 5-HT2 and 5-HT7 receptors. It has anti-hypertensive and muscle relaxant effects in animal studies.[1][2][3][4][5][6][7][8]

References

[edit]
  1. ^ Cohen ML, Robertson DW, Bloomquist WE, Wilson HC (April 1992). "LY215840, a potent 5-hydroxytryptamine (5-HT)2 receptor antagonist, blocks vascular and platelet 5-HT2 receptors and delays occlusion in a rabbit model of thrombosis". The Journal of Pharmacology and Experimental Therapeutics. 261 (1): 202–8. PMID 1560366.
  2. ^ Cushing DJ, Zgombick JM, Nelson DL, Cohen ML (June 1996). "LY215840, a high-affinity 5-HT7 receptor ligand, blocks serotonin-induced relaxation in canine coronary artery". The Journal of Pharmacology and Experimental Therapeutics. 277 (3): 1560–6. PMID 8667223.
  3. ^ Terrón JA, Falcón-Neri A (June 1999). "Pharmacological evidence for the 5-HT7 receptor mediating smooth muscle relaxation in canine cerebral arteries". British Journal of Pharmacology. 127 (3): 609–16. doi:10.1038/sj.bjp.0702580. PMC 1566051. PMID 10401550.
  4. ^ Meneses A, Terrón JA (June 2001). "Role of 5-HT(1A) and 5-HT(7) receptors in the facilitatory response induced by 8-OH-DPAT on learning consolidation". Behavioural Brain Research. 121 (1–2): 21–8. doi:10.1016/S0166-4328(00)00378-8. PMID 11275281. S2CID 26090343.
  5. ^ Watts SW, Yang P, Banes AK, Baez M (October 2001). "Activation of Erk mitogen-activated protein kinase proteins by vascular serotonin receptors". Journal of Cardiovascular Pharmacology. 38 (4): 539–51. doi:10.1097/00005344-200110000-00006. PMID 11588524. S2CID 43167169.
  6. ^ Lenglet S, Louiset E, Delarue C, Vaudry H, Contesse V (May 2002). "Activation of 5-HT(7) receptor in rat glomerulosa cells is associated with an increase in adenylyl cyclase activity and calcium influx through T-type calcium channels". Endocrinology. 143 (5): 1748–60. doi:10.1210/endo.143.5.8817. PMID 11956157.
  7. ^ Meneses A (December 2002). "Involvement of 5-HT(2A/2B/2C) receptors on memory formation: simple agonism, antagonism, or inverse agonism?". Cellular and Molecular Neurobiology. 22 (5–6): 675–88. doi:10.1023/A:1021800822997. PMID 12585687. S2CID 25703079.
  8. ^ Sánchez-Lopez A, Centurión D, Vázquez E, Arulmani U, Saxena PR, Villalón CM (October 2003). "Pharmacological profile of the 5-HT-induced inhibition of cardioaccelerator sympathetic outflow in pithed rats: correlation with 5-HT1 and putative 5-ht5A/5B receptors". British Journal of Pharmacology. 140 (4): 725–35. doi:10.1038/sj.bjp.0705489. PMC 1574076. PMID 14504136.



Stub icon

This drug article relating to the nervous system is a stub. You can help Wikipedia by expanding it.

Retrieved from "https://en.wikipedia.org/w/index.php?title=LY-215,840&oldid=1190944637"