MEDA: Difference between revisions
Appearance
Content deleted Content added
IznoRepeat (talk | contribs) m remove template per TFD; gen fixes |
Ira Leviton (talk | contribs) m Clean up duplicate template arguments using findargdups |
||
(6 intermediate revisions by 6 users not shown) | |||
Line 1: | Line 1: | ||
{{About|the psychedelic drug|the instrument on the Perseverance rover|Mars Environmental Dynamics Analyzer}} |
|||
{{one source|date=July 2019}} |
{{one source|date=July 2019}} |
||
{{chembox |
{{chembox |
||
Line 6: | Line 7: | ||
| ImageFile = MEDA.png |
| ImageFile = MEDA.png |
||
| ImageSize = 200px |
| ImageSize = 200px |
||
| |
| PIN = 1-(8-Methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)propan-2-amine |
||
| OtherNames = |
| OtherNames = |
||
|Section1={{Chembox Identifiers |
|Section1={{Chembox Identifiers |
||
Line 21: | Line 22: | ||
| CASNo_Ref = {{cascite|correct|??}} |
| CASNo_Ref = {{cascite|correct|??}} |
||
| CASNo = 23693-25-6 |
| CASNo = 23693-25-6 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = T2DAA4TB22 |
|||
| PubChem = 25798 |
| PubChem = 25798 |
||
| SMILES = NC(CC1=CC2=C(OCCO2)C(OC)=C1)C |
| SMILES = NC(CC1=CC2=C(OCCO2)C(OC)=C1)C |
Latest revision as of 02:08, 22 August 2022
This article relies largely or entirely on a single source. (July 2019) |
Names | |
---|---|
Preferred IUPAC name
1-(8-Methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)propan-2-amine | |
Identifiers | |
3D model (JSmol)
|
|
ChemSpider | |
KEGG | |
PubChem CID
|
|
UNII | |
| |
| |
Properties | |
C12H17NO3 | |
Molar mass | 223.272 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
MEDA (3-methoxy-4,5-ethylenedioxyamphetamine) is a lesser-known psychedelic drug. MEDA was first synthesized by Alexander Shulgin. In his book PiHKAL, the minimum dosage is listed as 200 mg, and the duration unknown.[1] MEDA produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MEDA.
See also
[edit]References
[edit]