3-Methylheptane is a branched alkane isomeric to octane. Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3. It has one stereocenter.
Names | |
---|---|
IUPAC name
3-Methylheptane
| |
Other names
2-Ethylhexane
| |
Identifiers | |
3D model (JSmol)
|
|
ECHA InfoCard | 100.008.783 |
EC Number |
|
PubChem CID
|
|
CompTox Dashboard (EPA)
|
|
| |
| |
Properties | |
C8H18 | |
Molar mass | 114.23 g.mol-1 |
Appearance | Clear liquid |
Density | 0.705 g.cm-3 |
Melting point | −121 °C (−186 °F; 152 K) |
Boiling point | +119 °C (246 °F; 392 K) |
Hazards | |
Occupational safety and health (OHS/OSH): | |
Main hazards
|
Harmful (Xn), Highly flammable (F+), Dangerous for the environment (N) |
Flash point | 7.2 °C |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Its refractive index is 1.398 (20 °C, D).[citation needed]
External links
- Non-stereospecific oxidation of DL-3-methylheptane by aPseudomonas
- Physical and chemical properties table