2,4,6-Trinitroaniline: Difference between revisions

Content deleted Content added
Health Concerns/Precautions: generic MSDS-style advice isn't appropriate for Wikipedia
Health and safety: that was tetranitroaniline, sorry
Tags: references removed Visual edit
(12 intermediate revisions by 11 users not shown)
Line 3:
| Watchedfields = changed
| verifiedrevid = 477210931
| ImageFile=Trinitroaniline structure.svg
| ImageSize=150px
| ImageFile1 = 2,4,6-Trinitroaniline-3D-balls.png
| ImageSize1 = 150
| ImageAlt1 = Picramide molecule
|IUPACName PIN = 2,4,6-trinitroanilineTrinitroaniline
| OtherNames = Picramide
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 9852
| InChI = 1/C6H4N4O6/c7-6-4(9(13)14)1-3(8(11)12)2-5(6)10(15)16/h1-2H,7H2
| InChIKey = IAHOUQOWMXVMEH-UHFFFAOYAP
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H4N4O6/c7-6-4(9(13)14)1-3(8(11)12)2-5(6)10(15)16/h1-2H,7H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
Line 21:
| CASNo_Ref = {{cascite|changed|??}}
| CASNo=489-98-5
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem=10271
| UNII = ZL7CZQ6FZC
| SMILES = c1c(cc(c(c1[N+](=O)[O-])N)[N+](=O)[O-])[N+](=O)[O-]
| PubChem=10271
| SMILES = c1c(cc(c(c1[N+](=O)[O-])N)[N+](=O)[O-])[N+](=O)[O-]
}}
|Section2={{Chembox Properties
| Formula=C<sub>6</sub>H<sub>4</sub>N<sub>4</sub>O<sub>6</sub>
| MolarMass=228.12 g/mol
| Appearance=yellow/orange/red powder
| Density=1.8 g/cm<sup>3</sup>
| MeltingPtC=188
| BoilingPt=explodes before boiling
| Solubility=insoluble
}}
|Section3={{Chembox Hazards
| MainHazards=instantaneous explosion
| FlashPt=unknown
| AutoignitionPt=unknown
}}
| Section6 = {{Chembox Explosive
| ShockSens = unknown
| FrictionSens = unknown
| ExplosiveVDetonationV = 7,300 m/s
| REFactor = }}
}}
 
'''2,4,6-Trinitroaniline''', C<sub>6</sub>H<sub>4</sub>N<sub>4</sub>O<sub>6</sub>, abbreviated as TNA and also known as '''picramide''', a nitrated [[amine]]. Materials in this group range from slight to strong [[oxidizing agents]]. If mixed with [[reducing agents]], including [[hydride]]s, [[sulfide]]s and [[nitride]]s, they may begin a vigorous reaction that culminates in a detonation. The aromatic nitro compounds may explode in the presence of a base such as [[sodium hydroxide]] or [[potassium hydroxide]] even in the presence of water or organic solvents. The explosive tendencies of aromatic nitro compounds are increased by the presence of multiple nitro groups.<ref>{{Cite web|url=http://cameochemicals.noaa.gov/chemical/21189|title=2,4,6-TRINITROANILINE &#124; CAMEO Chemicals &#124; NOAA}}</ref> The appearance of trinitroaniline varies from yellow to orange to red depending on its purity and concentration.
 
==Applications/Uses==
Trinitroaniline is only used in modern times in the small warheads of some explosive devices such as [[Mortar (weapon)|mortars]]. In [[World War II]] it was used by [[Imperial Japanese Navy]] as '''Type 97 ''bakuyaku''''' (Model 1931 explosive) in some versions of gun [[projectile]]s instead of less stable burster [[Picric acid|''schimose'']].<ref>{{cite web | url=http://navweaps.com/Weapons/Gun_Data_p2.htm | title=Definitions and Information about Naval Guns - NavWeaps }}</ref> It was also used in the Yokosuka MXY-7 [[Ohka]], a [[kamikaze]] antishipping vesselhuman-guided rocket aircraft.
 
==Health and safety==
Trinitroaniline is dangerously explosive and also [[Hepatotoxicity|hepatoxic]].<ref>{{Cite web |title=2,4,6-Trinitroaniline - Hazardous Agents {{!}} Haz-Map |url=https://haz-map.com/Agents/1926 |access-date=2024-05-31 |website=haz-map.com}}</ref> Symptoms of exposure to this compound may include skin and eye irritation, headache, drowsiness, weakness, [[cyanosis]], and respiratory distress.{{medcn|date=April 2014}}
 
==References==
{{Reflist}}
 
==See also==
* [[Aniline]]
* [[Picric acid]]
* [[Tetryl]]
 
==References==
{{Reflist}}
*{{cite journal|doi=10.1021/j100668a017 |title=Crystal structure of 2,4,6-trinitroaniline |year=1972 |last1=Holden |first1=James R. |last2=Dickinson |first2=Charles |last3=Bock |first3=Charles M. |journal=The Journal of Physical Chemistry |volume=76 |issue=24 |pages=3597–3602 }}
 
{{DEFAULTSORT:Trinitroaniline, 2,4,6-}}
[[Category:Anilines]]
[[Category:NitrobenzenesNitrobenzene derivatives]]
[[Category:Explosive chemicals]]